The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-(2-(3-tert-butyl-5-methyl-7-oxo-7H-furo[3,2-g]chromen-6-yl)acetamido)-3-(5-hydroxy-1H-indol-3-yl)propanoic acid ID: ALA598785
PubChem CID: 1784865
Max Phase: Preclinical
Molecular Formula: C29H28N2O7
Molecular Weight: 516.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: ZINC 02129857 | CHEMBL598785|ZINC 02129857|BDBM50481414
Canonical SMILES: Cc1c(CC(=O)N[C@@H](Cc2c[nH]c3ccc(O)cc23)C(=O)O)c(=O)oc2cc3occ(C(C)(C)C)c3cc12
Standard InChI: InChI=1S/C29H28N2O7/c1-14-17-9-20-21(29(2,3)4)13-37-24(20)11-25(17)38-28(36)18(14)10-26(33)31-23(27(34)35)7-15-12-30-22-6-5-16(32)8-19(15)22/h5-6,8-9,11-13,23,30,32H,7,10H2,1-4H3,(H,31,33)(H,34,35)/t23-/m0/s1
Standard InChI Key: VQVMCKTVRYRYFK-QHCPKHFHSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
13.9206 -24.7811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1997 -27.2527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1979 -25.5997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4849 -26.8398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4816 -26.0155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6966 -25.7639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2147 -26.4328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7020 -27.0977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4385 -24.9803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9881 -24.3650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6308 -24.8120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2208 -24.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9133 -26.0088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9121 -26.8373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6251 -27.2503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3438 -26.8393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3449 -26.0108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6274 -25.5933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6274 -24.7683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0571 -27.2538 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0604 -25.6001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7739 -26.0143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4893 -25.6035 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7719 -26.8393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2028 -26.0178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9183 -25.6070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2008 -26.8428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4853 -27.2535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9143 -27.2570 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5064 -23.5098 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2491 -24.2946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3324 -23.5121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5849 -24.2983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3903 -24.4714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9441 -23.8592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6868 -23.0712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8820 -22.9019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7510 -24.0311 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4 5 2 0
18 19 1 0
6 9 1 0
16 20 2 0
4 2 1 0
17 21 1 0
9 10 1 0
21 22 1 0
2 14 2 0
22 23 1 0
9 11 1 0
22 24 2 0
25 23 1 1
9 12 1 0
25 26 1 0
13 14 1 0
25 27 1 0
13 3 2 0
27 28 2 0
3 5 1 0
27 29 1 0
26 1 1 0
1 33 1 0
5 6 1 0
6 7 2 0
32 30 1 0
30 31 1 0
31 1 2 0
7 8 1 0
8 4 1 0
32 33 2 0
13 18 1 0
33 34 1 0
14 15 1 0
34 35 2 0
15 16 1 0
35 36 1 0
16 17 1 0
36 37 2 0
37 32 1 0
17 18 2 0
35 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 516.55Molecular Weight (Monoisotopic): 516.1897AlogP: 4.69#Rotatable Bonds: 6Polar Surface Area: 145.77Molecular Species: ACIDHBA: 6HBD: 4#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.46CX Basic pKa: ┄CX LogP: 4.22CX LogD: 0.83Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.24Np Likeness Score: -0.07
References 1. Podvinec M, Lim SP, Schmidt T, Scarsi M, Wen D, Sonntag LS, Sanschagrin P, Shenkin PS, Schwede T.. (2010) Novel inhibitors of dengue virus methyltransferase: discovery by in vitro-driven virtual screening on a desktop computer grid., 53 (4): [PMID:20108931 ] [10.1021/jm900776m ]