The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-2-(4-((1-(2,4-dichlorobenzyl)-2,5-dioxoimidazolidin-4-ylidene)methyl)-2-methoxyphenoxy)propanoic acid ID: ALA598786
PubChem CID: 1311699
Max Phase: Preclinical
Molecular Formula: C21H18Cl2N2O6
Molecular Weight: 465.29
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: ZINC 01138375 | CHEMBL598786|ZINC 01138375|BDBM50481413
Canonical SMILES: COc1cc(/C=C2/NC(=O)N(Cc3ccc(Cl)cc3Cl)C2=O)ccc1O[C@H](C)C(=O)O
Standard InChI: InChI=1S/C21H18Cl2N2O6/c1-11(20(27)28)31-17-6-3-12(8-18(17)30-2)7-16-19(26)25(21(29)24-16)10-13-4-5-14(22)9-15(13)23/h3-9,11H,10H2,1-2H3,(H,24,29)(H,27,28)/b16-7+/t11-/m1/s1
Standard InChI Key: DPLIRFKSBJFEEF-PFJSLNBISA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
-3.8990 0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2500 1.3674 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.2544 0.2533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5052 -1.0462 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.0378 -0.7353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8969 0.4545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2024 -2.6932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2387 -0.8917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 -3.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0432 -3.5994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1418 -1.5335 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.4478 0.3794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.1126 -2.4159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2295 -3.6293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8356 -5.0014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9505 -6.2124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4591 -6.0514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8529 -4.6793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7381 -3.4683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.0287 -5.1303 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-2.7510 -7.0202 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15 16 1 0
3 4 1 0
16 17 2 0
17 12 1 0
7 9 1 0
13 18 1 0
4 5 1 0
18 19 1 0
9 10 1 0
15 20 1 0
20 1 2 0
5 1 1 0
5 21 2 0
9 11 2 0
3 22 2 0
1 2 1 0
4 23 1 0
6 12 1 0
23 24 1 0
24 25 2 0
12 13 2 0
25 26 1 0
6 7 1 0
26 27 2 0
13 14 1 0
27 28 1 0
2 3 1 0
28 29 2 0
29 24 1 0
14 15 2 0
25 30 1 0
7 8 1 6
27 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 465.29Molecular Weight (Monoisotopic): 464.0542AlogP: 3.95#Rotatable Bonds: 7Polar Surface Area: 105.17Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.41CX Basic pKa: ┄CX LogP: 3.57CX LogD: 0.16Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.47Np Likeness Score: -1.06
References 1. Podvinec M, Lim SP, Schmidt T, Scarsi M, Wen D, Sonntag LS, Sanschagrin P, Shenkin PS, Schwede T.. (2010) Novel inhibitors of dengue virus methyltransferase: discovery by in vitro-driven virtual screening on a desktop computer grid., 53 (4): [PMID:20108931 ] [10.1021/jm900776m ]