The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-((3-chlorophenyl)(phenyl)methyl)piperazin-1-yl)-2-(diphenylamino)ethanone ID: ALA598793
PubChem CID: 11641767
Max Phase: Preclinical
Molecular Formula: C31H30ClN3O
Molecular Weight: 496.05
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CN(c1ccccc1)c1ccccc1)N1CCN(C(c2ccccc2)c2cccc(Cl)c2)CC1
Standard InChI: InChI=1S/C31H30ClN3O/c32-27-14-10-13-26(23-27)31(25-11-4-1-5-12-25)34-21-19-33(20-22-34)30(36)24-35(28-15-6-2-7-16-28)29-17-8-3-9-18-29/h1-18,23,31H,19-22,24H2
Standard InChI Key: YZBMBXSAQFTDCP-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
7.4786 -12.5777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4786 -13.4027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7642 -13.8152 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0497 -13.4027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0497 -12.5777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7642 -12.1652 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7642 -14.6402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4786 -15.0527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0497 -15.0527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7642 -11.3402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4786 -10.9277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0497 -10.9277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0497 -10.1027 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3352 -9.6902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7642 -9.6902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3352 -8.8652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6207 -8.4527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9063 -8.8652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9063 -9.6902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6207 -10.1027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7642 -8.8652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4786 -8.4527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1931 -8.8652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1931 -9.6902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4786 -10.1027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0497 -15.8777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3352 -16.2902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6207 -15.8777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6207 -15.0527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3352 -14.6402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1931 -14.6402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9076 -15.0527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9076 -15.8777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1931 -16.2902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4786 -15.8777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3352 -17.1152 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
17 18 2 0
7 9 1 0
18 19 1 0
2 3 1 0
19 20 2 0
20 14 1 0
6 10 1 0
15 21 2 0
3 4 1 0
21 22 1 0
10 11 2 0
22 23 2 0
4 5 1 0
23 24 1 0
10 12 1 0
24 25 2 0
25 15 1 0
5 6 1 0
9 26 2 0
12 13 1 0
26 27 1 0
27 28 2 0
13 14 1 0
28 29 1 0
3 7 1 0
29 30 2 0
30 9 1 0
13 15 1 0
8 31 2 0
1 2 1 0
31 32 1 0
14 16 2 0
32 33 2 0
7 8 1 0
33 34 1 0
16 17 1 0
34 35 2 0
35 8 1 0
1 6 1 0
27 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 496.05Molecular Weight (Monoisotopic): 495.2077AlogP: 6.41#Rotatable Bonds: 7Polar Surface Area: 26.79Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 6.37CX LogP: 6.72CX LogD: 6.68Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.30Np Likeness Score: -1.19
References 1. Pajouhesh H, Feng ZP, Ding Y, Zhang L, Pajouhesh H, Morrison JL, Belardetti F, Tringham E, Simonson E, Vanderah TW, Porreca F, Zamponi GW, Mitscher LA, Snutch TP.. (2010) Structure-activity relationships of diphenylpiperazine N-type calcium channel inhibitors., 20 (4): [PMID:20117000 ] [10.1016/j.bmcl.2010.01.008 ]