The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-hexylthio-ATP-alpha-S ID: ALA598853
PubChem CID: 46228456
Max Phase: Preclinical
Molecular Formula: C16H28N5O12P3S2
Molecular Weight: 639.48
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCSc1nc(N)c2ncn([C@H]3O[C@@H](COP(O)(=S)OP(=O)(O)OP(=O)(O)O)[C@H](O)[C@@H]3O)c2n1
Standard InChI: InChI=1S/C16H28N5O12P3S2/c1-2-3-4-5-6-38-16-19-13(17)10-14(20-16)21(8-18-10)15-12(23)11(22)9(31-15)7-30-36(29,37)33-35(27,28)32-34(24,25)26/h8-9,11-12,15,22-23H,2-7H2,1H3,(H,27,28)(H,29,37)(H2,17,19,20)(H2,24,25,26)/t9-,11-,12-,15-,36?/m0/s1
Standard InChI Key: ZVZNYNIFYBLKFQ-PJPBMIAMSA-N
Molfile:
RDKit 2D
38 40 0 0 0 0 0 0 0 0999 V2000
4.8253 -13.8015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0048 -13.7152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8333 -12.9083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5478 -12.4958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1609 -13.0478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9678 -12.8763 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3034 -12.1226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1239 -12.2088 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5809 -13.4283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2954 -13.0158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0099 -13.4283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0099 -14.2533 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2954 -14.6658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5809 -14.2533 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7243 -13.0158 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2954 -15.4908 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.0099 -15.9033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2378 -14.5159 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4528 -14.3283 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0796 -12.5727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4122 -13.0576 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6585 -12.7221 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
0.9048 -12.3865 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2374 -12.8714 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
-0.4300 -13.3564 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1837 -13.0208 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
-1.9374 -12.6852 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7223 -13.5389 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5193 -13.7745 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3230 -13.4757 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.9941 -11.9684 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2475 -12.2040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8482 -12.2671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7243 -15.4908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4388 -15.9033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1533 -15.4908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8678 -15.9033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5822 -15.4908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
5 6 1 6
6 7 1 0
7 8 2 0
8 10 1 0
9 6 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
11 15 1 0
13 16 1 0
16 17 1 0
1 18 1 1
2 19 1 1
3 20 1 6
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
24 28 2 0
26 29 2 0
22 30 2 0
22 31 1 0
24 32 1 0
26 33 1 0
17 34 1 0
1 2 1 0
34 35 1 0
2 3 1 0
35 36 1 0
3 4 1 0
36 37 1 0
4 5 1 0
37 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 639.48Molecular Weight (Monoisotopic): 639.0389AlogP: 1.16#Rotatable Bonds: 14Polar Surface Area: 262.06Molecular Species: ACIDHBA: 15HBD: 7#RO5 Violations: 3HBA (Lipinski): 17HBD (Lipinski): 8#RO5 Violations (Lipinski): 3CX Acidic pKa: 1.06CX Basic pKa: 5.12CX LogP: -1.00CX LogD: -6.17Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.07Np Likeness Score: 0.54
References 1. Eliahu S, Barr HM, Camden J, Weisman GA, Fischer B.. (2010) A novel insulin secretagogue based on a dinucleoside polyphosphate scaffold., 53 (6): [PMID:20175517 ] [10.1021/jm901621h ]