1-(4-((3,5-dimethoxyphenyl)(phenyl)methyl)piperazin-1-yl)-3,3-diphenylpropan-1-one

ID: ALA599016

PubChem CID: 9984183

Max Phase: Preclinical

Molecular Formula: C34H36N2O3

Molecular Weight: 520.67

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(OC)cc(C(c2ccccc2)N2CCN(C(=O)CC(c3ccccc3)c3ccccc3)CC2)c1

Standard InChI:  InChI=1S/C34H36N2O3/c1-38-30-22-29(23-31(24-30)39-2)34(28-16-10-5-11-17-28)36-20-18-35(19-21-36)33(37)25-32(26-12-6-3-7-13-26)27-14-8-4-9-15-27/h3-17,22-24,32,34H,18-21,25H2,1-2H3

Standard InChI Key:  RPLRXHLXRQIHHQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
    8.0621   -8.5924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0621   -9.4174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3476   -9.8299    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6331   -9.4174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6331   -8.5924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3476   -8.1799    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3476  -10.6549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6331  -11.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0621  -11.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3476   -7.3549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0621   -6.9424    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6331   -6.9424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6331   -6.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9186   -5.7049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3476   -5.7049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9186   -4.8799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2042   -4.4674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4897   -4.8799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4897   -5.7049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2042   -6.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3476   -4.8799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0621   -4.4674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7765   -4.8799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7765   -5.7049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0621   -6.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7765  -10.6549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4910  -11.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4910  -11.8924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7765  -12.3049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0621  -11.8924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6331  -11.8924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9186  -12.3049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2042  -11.8924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2042  -11.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9186  -10.6549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9186  -13.1299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6331  -13.5424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4897  -10.6549    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4897   -9.8299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
 19 20  2  0
 20 14  1  0
  6 10  1  0
 15 21  2  0
  3  4  1  0
 21 22  1  0
 10 11  2  0
 22 23  2  0
  4  5  1  0
 23 24  1  0
 10 12  1  0
 24 25  2  0
 25 15  1  0
  5  6  1  0
  9 26  2  0
 12 13  1  0
 26 27  1  0
 27 28  2  0
 13 14  1  0
 28 29  1  0
  3  7  1  0
 29 30  2  0
 30  9  1  0
 13 15  1  0
  8 31  2  0
  1  2  1  0
 31 32  1  0
 14 16  2  0
 32 33  2  0
  7  8  1  0
 33 34  1  0
 16 17  1  0
 34 35  2  0
 35  8  1  0
  1  6  1  0
 17 18  2  0
 36 37  1  0
 32 36  1  0
  7  9  1  0
 18 19  1  0
 38 39  1  0
 34 38  1  0
M  END

Associated Targets(Human)

CACNA2D1 Tclin N-type calcium channel alpha-1b/alpha2delta-1/beta-1b (50 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Cacna1b Voltage-gated N-type calcium channel alpha-1B subunit (471 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 520.67Molecular Weight (Monoisotopic): 520.2726AlogP: 6.16#Rotatable Bonds: 9
Polar Surface Area: 42.01Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 6.53CX LogP: 6.16CX LogD: 6.10
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.27Np Likeness Score: -0.72

References

1. Pajouhesh H, Feng ZP, Ding Y, Zhang L, Pajouhesh H, Morrison JL, Belardetti F, Tringham E, Simonson E, Vanderah TW, Porreca F, Zamponi GW, Mitscher LA, Snutch TP..  (2010)  Structure-activity relationships of diphenylpiperazine N-type calcium channel inhibitors.,  20  (4): [PMID:20117000] [10.1016/j.bmcl.2010.01.008]
2.  (2004)  Calcium channel inhibitors comprising benzhydril spaced from piperazine,