N,4-dibenzhydrylpiperazine-1-carboxamide

ID: ALA599217

Max Phase: Preclinical

Molecular Formula: C31H31N3O

Molecular Weight: 461.61

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(NC(c1ccccc1)c1ccccc1)N1CCN(C(c2ccccc2)c2ccccc2)CC1

Standard InChI:  InChI=1S/C31H31N3O/c35-31(32-29(25-13-5-1-6-14-25)26-15-7-2-8-16-26)34-23-21-33(22-24-34)30(27-17-9-3-10-18-27)28-19-11-4-12-20-28/h1-20,29-30H,21-24H2,(H,32,35)

Standard InChI Key:  PPVBMJIAJXVQFX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   -2.5885    0.8711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7630    0.8711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3546    1.5785    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7630    2.2946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5885    2.2946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0055    1.5785    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8311    1.5774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2427    2.2922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2407    0.8655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8302    3.0059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2411    3.7203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0676    3.7196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4812    2.9986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0638    2.2871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0659    0.8658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4796    0.1506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0637   -0.5652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2340   -0.5614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8281    0.1543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5290    1.5774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1153    0.8655    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7102    0.8644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1199    0.1483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1219    1.5751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9472    1.5693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3630    2.2833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9490    3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1193    2.9989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7114    2.2842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7060   -0.5653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1149   -1.2808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9413   -1.2824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3569   -0.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9415    0.1501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1133    2.2922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 16 17  2  0
  1  6  1  0
 17 18  1  0
  7  9  1  0
 18 19  2  0
 19  9  1  0
  2  3  1  0
  3 20  1  0
  8 10  2  0
 20 21  1  0
  3  4  1  0
 21 22  1  0
 10 11  1  0
 22 23  1  0
  4  5  1  0
 22 24  1  0
 11 12  2  0
 24 25  2  0
  5  6  1  0
 25 26  1  0
 12 13  1  0
 26 27  2  0
 27 28  1  0
 13 14  2  0
 28 29  2  0
 29 24  1  0
 14  8  1  0
 23 30  2  0
  6  7  1  0
 30 31  1  0
  9 15  2  0
 31 32  2  0
  1  2  1  0
 32 33  1  0
 15 16  1  0
 33 34  2  0
 34 23  1  0
  7  8  1  0
 20 35  2  0
M  END

Alternative Forms

  1. Parent:

    ALA599217

    ---

Associated Targets(Human)

CACNA2D1 Tclin Voltage-dependent L-type calcium channel alpha1C/alpha2delta/beta1b (64 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CACNA2D1 Tclin N-type calcium channel alpha-1b/alpha2delta-1/beta-1b (50 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Cacna2d1 Voltage-dependent L-type calcium channel subunit beta-1/alpha-1B/alpha-2/delta-1 (26 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 461.61Molecular Weight (Monoisotopic): 461.2467AlogP: 5.89#Rotatable Bonds: 6
Polar Surface Area: 35.58Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.26CX LogP: 6.17CX LogD: 5.93
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.39Np Likeness Score: -1.03

References

1. Pajouhesh H, Feng ZP, Ding Y, Zhang L, Pajouhesh H, Morrison JL, Belardetti F, Tringham E, Simonson E, Vanderah TW, Porreca F, Zamponi GW, Mitscher LA, Snutch TP..  (2010)  Structure-activity relationships of diphenylpiperazine N-type calcium channel inhibitors.,  20  (4): [PMID:20117000] [10.1016/j.bmcl.2010.01.008]
2. Zamponi GW, Feng ZP, Zhang L, Pajouhesh H, Ding Y, Belardetti F, Pajouhesh H, Dolphin D, Mitscher LA, Snutch TP..  (2009)  Scaffold-based design and synthesis of potent N-type calcium channel blockers.,  19  (22): [PMID:19815411] [10.1016/j.bmcl.2009.09.008]

Source