The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2Z,5Z)-2-{[4-(Adamantan-1-yl)-1,3-thiazol-2-yl]imino}-5-(4-methoxy-benzylidene)-1,3-thiazolidin-4-one ID: ALA600063
PubChem CID: 136066068
Max Phase: Preclinical
Molecular Formula: C24H25N3O2S2
Molecular Weight: 451.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=C2\S/C(=N\c3nc(C45CC6CC(CC(C6)C4)C5)cs3)NC2=O)cc1
Standard InChI: InChI=1S/C24H25N3O2S2/c1-29-18-4-2-14(3-5-18)9-19-21(28)26-23(31-19)27-22-25-20(13-30-22)24-10-15-6-16(11-24)8-17(7-15)12-24/h2-5,9,13,15-17H,6-8,10-12H2,1H3,(H,25,26,27,28)/b19-9-
Standard InChI Key: IIWGBNMCEMKOCK-OCKHKDLRSA-N
Molfile:
RDKit 2D
31 36 0 0 0 0 0 0 0 0999 V2000
-4.0775 -19.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1128 -20.3502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5373 -20.1120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8214 -20.6201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3034 -20.3788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2629 -21.2515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9774 -20.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9615 -21.6142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5864 -20.9465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7288 -21.8724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0289 -23.5401 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.3655 -23.0415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6356 -22.2577 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4647 -22.2728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7070 -23.0657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6551 -23.4610 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9369 -23.0556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2645 -23.5398 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3990 -23.0496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1378 -22.2669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6872 -22.2737 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.1857 -23.2982 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6111 -21.5912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2628 -20.8434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6660 -20.1198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2409 -19.4136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5848 -19.4286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9836 -20.1556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5562 -20.8588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0115 -18.7225 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8364 -18.7390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14 8 1 0
4 6 1 0
12 16 1 0
5 6 1 0
16 17 2 0
17 18 1 0
7 8 1 0
3 7 1 0
2 9 1 0
6 10 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 17 1 0
10 8 1 0
19 22 2 0
8 9 1 0
20 23 2 0
12 13 2 0
23 24 1 0
24 25 2 0
1 2 1 0
25 26 1 0
1 3 1 0
26 27 2 0
2 4 1 0
27 28 1 0
3 5 1 0
28 29 2 0
29 24 1 0
11 12 1 0
27 30 1 0
13 14 1 0
14 15 2 0
15 11 1 0
30 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 451.62Molecular Weight (Monoisotopic): 451.1388AlogP: 5.51#Rotatable Bonds: 4Polar Surface Area: 63.58Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.62CX Basic pKa: ┄CX LogP: 5.83CX LogD: 5.83Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.62Np Likeness Score: -1.07
References 1. Omar K, Geronikaki A, Zoumpoulakis P, Camoutsis C, Soković M, Cirić A, Glamoclija J.. (2010) Novel 4-thiazolidinone derivatives as potential antifungal and antibacterial drugs., 18 (1): [PMID:19914077 ] [10.1016/j.bmc.2009.10.041 ]