The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
GNF-Pf-5058 ID: ALA601180
PubChem CID: 15989993
Max Phase: Preclinical
Molecular Formula: C19H20N4O4
Molecular Weight: 368.39
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Synonyms: GNF-Pf-5058 | GNF-Pf-5058|MLS001199677|SMR000560127|ethyl 4-[(4-amino-6,7-dimethoxyquinazolin-2-yl)amino]benzoate|CHEMBL601180|BDBM79635|cid_15989993|HMS1821K02|HMS2880O11|AKOS000113808|NCGC00107259-01|C301-4527|ethyl 4-[(4-azanyl-6,7-dimethoxy-quinazolin-2-yl)amino]benzoate|4-[(4-amino-6,7-dimethoxy-2-quinazolinyl)amino]benzoic acid ethyl ester|4-[(4-amino-6,7-dimethoxy-quinazolin-2-yl)amino]benzoic acid ethyl ester
Canonical SMILES: CCOC(=O)c1ccc(Nc2nc(N)c3cc(OC)c(OC)cc3n2)cc1
Standard InChI: InChI=1S/C19H20N4O4/c1-4-27-18(24)11-5-7-12(8-6-11)21-19-22-14-10-16(26-3)15(25-2)9-13(14)17(20)23-19/h5-10H,4H2,1-3H3,(H3,20,21,22,23)
Standard InChI Key: YGNWIQTXRCJLGP-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
-1.5330 10.3430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5752 9.7483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5838 8.2475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8873 7.5036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9233 8.1092 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8958 6.0028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1976 5.2575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2030 3.7575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9067 3.0027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9091 1.5019 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2928 -2.6973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8911 -1.5017 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8894 -2.7017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8911 1.5017 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8894 2.7017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6050 3.7481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5995 5.2481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
4 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
13 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 1 0
17 20 1 0
20 21 1 0
21 22 1 0
20 23 2 0
23 24 1 0
24 15 1 0
24 25 2 0
25 11 1 0
9 26 1 0
26 27 2 0
27 6 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 368.39Molecular Weight (Monoisotopic): 368.1485AlogP: 3.15#Rotatable Bonds: 6Polar Surface Area: 108.59Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.96CX Basic pKa: 5.52CX LogP: 3.35CX LogD: 3.35Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.64Np Likeness Score: -0.85
References 1. Plouffe D, Brinker A, McNamara C, Henson K, Kato N, Kuhen K, Nagle A, Adrián F, Matzen JT, Anderson P, Nam TG, Gray NS, Chatterjee A, Janes J, Yan SF, Trager R, Caldwell JS, Schultz PG, Zhou Y, Winzeler EA.. (2008) In silico activity profiling reveals the mechanism of action of antimalarials discovered in a high-throughput screen., 105 (26): [PMID:18579783 ] [10.1073/pnas.0802982105 ] 2. PubChem BioAssay data set, 3. PubChem BioAssay data set,