The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1R,5S,7R)-3-benzyl-7-(4-(2-hydroxyethyl)piperazine-1-carbonyl)-6,8-dioxa-3-azabicyclo[3.2.1]octan-2-one ID: ALA601919
PubChem CID: 46229297
Max Phase: Preclinical
Molecular Formula: C19H25N3O5
Molecular Weight: 375.43
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C([C@@H]1O[C@H]2CN(Cc3ccccc3)C(=O)[C@@H]1O2)N1CCN(CCO)CC1
Standard InChI: InChI=1S/C19H25N3O5/c23-11-10-20-6-8-21(9-7-20)18(24)16-17-19(25)22(13-15(26-16)27-17)12-14-4-2-1-3-5-14/h1-5,15-17,23H,6-13H2/t15-,16-,17-/m1/s1
Standard InChI Key: MNINKTQTTWKONY-BRWVUGGUSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
16.9540 2.6055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7500 2.8073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4104 2.3097 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6150 1.8512 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.4359 1.4861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9940 1.1168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8044 0.9574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1579 1.0817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1685 0.2567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8670 1.5033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4083 1.9125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7903 1.8290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3973 1.1036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5719 1.0856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1789 0.3611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6106 -0.3430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4395 -0.3180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8288 0.4070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4984 0.4573 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.7458 3.6333 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
17.8000 0.1333 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
20.5896 1.0957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2966 1.5138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2902 2.3391 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.5707 2.7446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8574 2.3248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9979 2.7581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7161 2.3521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7235 1.5271 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13 14 2 0
6 7 1 0
14 15 1 0
1 4 1 0
15 16 2 0
16 17 1 0
3 5 1 0
17 18 2 0
18 13 1 0
8 9 2 0
6 19 2 0
8 10 1 0
2 20 1 1
5 8 1 1
7 21 1 1
10 22 1 0
2 3 1 0
7 11 1 0
2 11 1 0
4 6 1 0
4 12 1 0
10 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
1 2 1 0
12 13 1 0
27 28 1 0
24 27 1 0
5 7 1 0
28 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 375.43Molecular Weight (Monoisotopic): 375.1794AlogP: -0.72#Rotatable Bonds: 5Polar Surface Area: 82.55Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.06CX Basic pKa: 6.63CX LogP: -0.40CX LogD: -0.47Aromatic Rings: 1Heavy Atoms: 27QED Weighted: 0.73Np Likeness Score: -0.66
References 1. Trabocchi A, Mannino C, Machetti F, De Bernardis F, Arancia S, Cauda R, Cassone A, Guarna A.. (2010) Identification of inhibitors of drug-resistant Candida albicans strains from a library of bicyclic peptidomimetic compounds., 53 (6): [PMID:20184325 ] [10.1021/jm901734u ]