The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R,Z)-4-(furan-2-yl(hydroxy)methylene)-5-(3-phenoxyphenyl)-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione ID: ALA604091
PubChem CID: 986480
Max Phase: Preclinical
Molecular Formula: C27H20N2O5
Molecular Weight: 452.47
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: ZINC 00633950 | CHEMBL604091|ZINC 00633950|BDBM50481402
Canonical SMILES: O=C1C(=O)N(Cc2cccnc2)[C@H](c2cccc(Oc3ccccc3)c2)/C1=C(/O)c1ccco1
Standard InChI: InChI=1S/C27H20N2O5/c30-25(22-12-6-14-33-22)23-24(29(27(32)26(23)31)17-18-7-5-13-28-16-18)19-8-4-11-21(15-19)34-20-9-2-1-3-10-20/h1-16,24,30H,17H2/b25-23-/t24-/m1/s1
Standard InChI Key: VJDJKGFSWOCZNX-QQYUXEJHSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
4.2010 -3.2956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9531 -1.9978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9511 -0.8815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7343 -2.9815 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6874 -4.3927 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1467 -1.8742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2567 0.5852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3967 0.9602 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1381 1.5857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3031 3.0638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9295 3.6665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9319 2.5464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6889 1.2514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 3.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2947 3.7547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2938 5.2548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8919 5.2564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8928 3.7564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5923 6.0056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5943 3.0056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6137 -3.9759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9143 -5.4464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7938 -6.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0972 -7.9127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5211 -8.3844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6416 -7.3872 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3382 -5.9182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 8 2 0
16 17 1 0
3 4 1 0
17 18 2 0
8 9 1 0
18 19 1 0
4 5 1 0
19 20 2 0
20 15 1 0
8 10 1 0
19 21 1 0
10 11 1 0
21 22 1 0
22 23 2 0
5 1 1 0
24 25 1 0
1 2 1 0
1 6 2 0
11 12 1 0
22 27 1 0
23 26 1 0
26 24 2 0
25 27 2 0
12 13 2 0
5 28 1 0
13 14 1 0
28 29 1 0
14 10 2 0
29 30 2 0
2 7 2 0
30 31 1 0
4 15 1 6
31 32 2 0
2 3 1 0
32 33 1 0
15 16 2 0
33 34 2 0
34 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.47Molecular Weight (Monoisotopic): 452.1372AlogP: 5.09#Rotatable Bonds: 6Polar Surface Area: 92.87Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.37CX Basic pKa: 5.01CX LogP: 3.22CX LogD: 1.37Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.25Np Likeness Score: -1.20
References 1. Podvinec M, Lim SP, Schmidt T, Scarsi M, Wen D, Sonntag LS, Sanschagrin P, Shenkin PS, Schwede T.. (2010) Novel inhibitors of dengue virus methyltransferase: discovery by in vitro-driven virtual screening on a desktop computer grid., 53 (4): [PMID:20108931 ] [10.1021/jm900776m ]