The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Benzo[1,3]dioxol-5-yl-5-[4-(2-fluoroethoxy)phenyl]-5-hydroxy-4-(3,4,5-trimethoxybenzyl)-5H-furan-2-one ID: ALA604286
PubChem CID: 45257115
Max Phase: Preclinical
Molecular Formula: C29H27FO9
Molecular Weight: 538.52
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(CC2=C(c3ccc4c(c3)OCO4)C(=O)OC2(O)c2ccc(OCCF)cc2)cc(OC)c1OC
Standard InChI: InChI=1S/C29H27FO9/c1-33-24-13-17(14-25(34-2)27(24)35-3)12-21-26(18-4-9-22-23(15-18)38-16-37-22)28(31)39-29(21,32)19-5-7-20(8-6-19)36-11-10-30/h4-9,13-15,32H,10-12,16H2,1-3H3
Standard InChI Key: UOCWQSCYEUUPBJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
-1.7653 -11.1106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9833 -10.8506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9871 -10.0268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7748 -9.7760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2518 -10.4469 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0156 -11.8958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5649 -8.9732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4930 -9.3603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4894 -8.5294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2068 -8.1138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9269 -8.5280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9250 -9.3622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2071 -9.7740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6407 -8.1163 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6409 -7.2922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2682 -9.6239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2578 -8.7998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4646 -8.4011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4754 -7.5778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2336 -7.1560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9548 -7.5634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9620 -8.3853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2698 -11.2536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2636 -12.0787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4530 -12.4842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4365 -10.8355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1536 -11.2373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1640 -12.0651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9545 -12.3111 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4328 -11.6352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9377 -10.9717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2243 -6.3320 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6647 -7.1449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6572 -6.3208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9333 -5.9119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1944 -7.1751 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9026 -7.5966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3547 -6.8804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3549 -6.0563 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18 19 1 0
4 5 1 0
19 20 2 0
9 10 1 0
20 21 1 0
5 1 1 0
21 22 2 0
22 17 1 0
10 11 2 0
1 2 1 0
23 24 2 0
11 12 1 0
24 25 1 0
25 28 2 0
1 6 2 0
27 26 2 0
26 23 1 0
2 23 1 0
27 28 1 0
12 13 2 0
13 8 1 0
11 14 1 0
4 7 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 27 1 0
14 15 1 0
20 32 1 0
2 3 2 0
21 33 1 0
3 16 1 0
33 34 1 0
4 8 1 0
32 35 1 0
16 17 1 0
19 36 1 0
3 4 1 0
36 37 1 0
17 18 2 0
15 38 1 0
8 9 2 0
38 39 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 538.52Molecular Weight (Monoisotopic): 538.1639AlogP: 4.19#Rotatable Bonds: 10Polar Surface Area: 101.91Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.55CX Basic pKa: ┄CX LogP: 4.81CX LogD: 4.81Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.38Np Likeness Score: 0.36
References 1. Höltke C, Law MP, Wagner S, Kopka K, Faust A, Breyholz HJ, Schober O, Bremer C, Riemann B, Schäfers M.. (2009) PET-compatible endothelin receptor radioligands: synthesis and first in vitro and in vivo studies., 17 (20): [PMID:19766010 ] [10.1016/j.bmc.2009.08.058 ]