The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Sodium salt 5-acetylamino-2-(3,4-dihydroxy-5-methoxy-tetrahydro-furan-2-ylmethylsulfanyl)-4-hydroxy-6-((1R,2R)-1,2,3-trihydroxy-propyl)-tetrahydro-pyran-2-carboxylate ID: ALA605049
PubChem CID: 46874449
Max Phase: Preclinical
Molecular Formula: C17H28NNaO12S
Molecular Weight: 471.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CO[C@H]1O[C@H](CSC2(C(=O)[O-])CC(O)C(NC(C)=O)C([C@@H](O)[C@H](O)CO)O2)[C@@H](O)[C@@H]1O.[Na+]
Standard InChI: InChI=1S/C17H29NO12S.Na/c1-6(20)18-10-7(21)3-17(16(26)27,30-14(10)11(23)8(22)4-19)31-5-9-12(24)13(25)15(28-2)29-9;/h7-15,19,21-25H,3-5H2,1-2H3,(H,18,20)(H,26,27);/q;+1/p-1/t7?,8-,9-,10?,11+,12-,13+,14?,15+,17?;/m1./s1
Standard InChI Key: GMMAIYWWBLQXBJ-AISVHYKFSA-M
Molfile:
RDKit 2D
34 34 0 0 0 0 0 0 0 0999 V2000
6.3500 -1.3500 0.0000 Na 0 0 0 0 0 15 0 0 0 0 0 0
4.3792 -2.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2667 -2.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4875 -2.8792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3375 -3.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5750 -4.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2375 -3.6792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7292 -3.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6292 -4.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6292 -4.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1792 -3.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9917 -2.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3750 -1.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6042 -3.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0667 -3.0792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3042 -3.1917 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.8625 -4.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4042 -3.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1458 -2.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5125 -0.6167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2292 -0.6250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6958 -5.3042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4833 -5.5250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7667 -5.7667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7125 -1.7458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2417 -5.1792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9417 -4.2042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5125 -1.0250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5458 -1.8417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4125 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0000 -3.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9542 -5.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7708 -1.7167 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.8000 -1.0250 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3 4 1 0
4 2 1 0
5 14 1 0
6 10 1 0
7 11 1 0
8 2 1 0
9 7 1 0
10 11 1 0
11 18 1 1
12 3 1 0
13 2 1 0
14 8 1 0
15 5 1 0
16 2 1 0
17 15 1 0
18 16 1 0
19 12 1 0
20 13 1 0
21 13 2 0
22 17 2 0
6 23 1 6
10 24 1 6
12 25 1 6
9 26 1 6
14 27 1 0
19 28 1 1
29 30 1 0
30 19 1 0
31 17 1 0
32 26 1 0
12 33 1 1
19 34 1 6
5 3 1 0
6 9 1 0
M CHG 2 1 1 20 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 471.48Molecular Weight (Monoisotopic): 471.1410AlogP: -4.04#Rotatable Bonds: 9Polar Surface Area: 215.47Molecular Species: ACIDHBA: 12HBD: 8#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 8#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.31CX Basic pKa: ┄CX LogP: -3.53CX LogD: -6.96Aromatic Rings: ┄Heavy Atoms: 31QED Weighted: 0.16Np Likeness Score: 1.54
References 1. Kiefel MJ, Beisner B, Bennett S, Holmes ID, von Itzstein M.. (1996) Synthesis and biological evaluation of N-acetylneuraminic acid-based rotavirus inhibitors., 39 (6): [PMID:8632438 ] [10.1021/jm950611f ]