N-(4-(N-(5-chloro-2-methylphenyl)sulfamoyl)phenyl)naphthalene-2-sulfonamide

ID: ALA605779

PubChem CID: 1265824

Max Phase: Preclinical

Molecular Formula: C23H19ClN2O4S2

Molecular Weight: 487.00

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: ZINC 01078518 | CHEMBL605779|ZINC 01078518|BDBM50481424|AKOS003999890

Canonical SMILES:  Cc1ccc(Cl)cc1NS(=O)(=O)c1ccc(NS(=O)(=O)c2ccc3ccccc3c2)cc1

Standard InChI:  InChI=1S/C23H19ClN2O4S2/c1-16-6-8-19(24)15-23(16)26-31(27,28)21-12-9-20(10-13-21)25-32(29,30)22-11-7-17-4-2-3-5-18(17)14-22/h2-15,25-26H,1H3

Standard InChI Key:  HJHVDDJLCIDJRS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    4.8788  -14.1997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5933  -14.6122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3078  -14.1997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3078  -13.3747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5933  -12.9622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8788  -13.3747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0223  -14.6122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1644  -12.9622    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    7.0223  -12.9622    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0223  -12.1372    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.0223  -11.3122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8473  -12.1372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1973  -12.1372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7367  -10.8997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7367  -10.0747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0223   -9.6622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3078  -10.0747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3078  -10.8997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0223   -8.8372    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7367   -8.4247    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.4512   -8.0122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1492   -9.1391    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3242   -7.7102    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4512   -7.1872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1657   -6.7747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1657   -8.4247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8801   -8.0122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8801   -7.1872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5946   -6.7747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3091   -7.1872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3091   -8.0122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5946   -8.4247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 15 16  2  0
  6  8  1  0
 16 17  1  0
 17 18  2  0
 18 11  1  0
  4  9  1  0
 16 19  1  0
  4  5  1  0
 19 20  1  0
  9 10  1  0
 20 21  1  0
  2  3  1  0
 20 22  2  0
 10 11  1  0
 20 23  2  0
  5  6  2  0
 21 24  2  0
 10 12  2  0
 24 25  1  0
 25 28  2  0
  6  1  1  0
 27 26  2  0
 26 21  1  0
 10 13  2  0
  1  2  2  0
 27 28  1  0
 11 14  2  0
 28 29  1  0
  3  7  1  0
 29 30  2  0
 14 15  1  0
 30 31  1  0
  3  4  2  0
 31 32  2  0
 32 27  1  0
M  END

Associated Targets(Human)

A549 (127892 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Genome polyprotein (78 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
dengue virus type 2 (2400 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 487.00Molecular Weight (Monoisotopic): 486.0475AlogP: 5.40#Rotatable Bonds: 6
Polar Surface Area: 92.34Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.36CX Basic pKa: CX LogP: 5.06CX LogD: 4.73
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.38Np Likeness Score: -1.57

References

1. Podvinec M, Lim SP, Schmidt T, Scarsi M, Wen D, Sonntag LS, Sanschagrin P, Shenkin PS, Schwede T..  (2010)  Novel inhibitors of dengue virus methyltransferase: discovery by in vitro-driven virtual screening on a desktop computer grid.,  53  (4): [PMID:20108931] [10.1021/jm900776m]

Source