The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(3-(3-cyano-4,5,6,7-tetrahydrobenzo[b]thiophen-2-ylcarbamoyl)phenylsulfonamido)benzoic acid ID: ALA605959
PubChem CID: 2203542
Max Phase: Preclinical
Molecular Formula: C23H19N3O5S2
Molecular Weight: 481.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: ZINC 02849675 | MLS000693452|SMR000299999|4-{[(3-{[(3-cyano-4,5,6,7-tetrahydro-1-benzothien-2-yl)amino]carbonyl}phenyl)sulfonyl]amino}benzoic acid|CHEMBL605959|BDBM50424|cid_2203542|HMS2769D21|ZINC 02849675|4-[[3-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamoyl]phenyl]sulfonylamino]benzoic acid|4-[[3-[(3-cyano-4,5,6,7-tetrahydrobenzothiophen-2-yl)carbamoyl]phenyl]sulfonylamino]benzoic Acid|4-[[3-[[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-oxomethyl]phenyl]sulfonylamino]b Show More⌵
Canonical SMILES: N#Cc1c(NC(=O)c2cccc(S(=O)(=O)Nc3ccc(C(=O)O)cc3)c2)sc2c1CCCC2
Standard InChI: InChI=1S/C23H19N3O5S2/c24-13-19-18-6-1-2-7-20(18)32-22(19)25-21(27)15-4-3-5-17(12-15)33(30,31)26-16-10-8-14(9-11-16)23(28)29/h3-5,8-12,26H,1-2,6-7H2,(H,25,27)(H,28,29)
Standard InChI Key: GYKLQZOUNYFRKC-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
10.5446 -1.4734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5446 -2.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8302 -2.7109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8302 -1.0609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1157 -1.4734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1157 -2.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3311 -2.5533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8462 -1.8859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3311 -1.2185 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.0761 -3.3380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8212 -4.1226 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0212 -1.8859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6087 -1.1714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7837 -1.1714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0212 -0.4570 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3712 -1.8859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5462 -1.8859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1337 -1.1714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5462 -0.4570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3712 -0.4570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1337 0.2575 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.7212 0.9720 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8481 0.6700 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4192 -0.1550 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1337 1.6865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7212 2.4009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9587 3.1154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3712 2.4009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1337 3.1154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9587 1.6865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3712 3.8299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9587 4.5443 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1962 3.8299 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14 16 2 0
6 7 1 0
16 17 1 0
7 8 2 0
17 18 2 0
8 9 1 0
18 19 1 0
9 5 1 0
19 20 2 0
20 14 1 0
5 4 1 0
19 21 1 0
7 10 1 0
21 22 1 0
5 6 2 0
21 23 2 0
10 11 3 0
21 24 2 0
22 25 1 0
25 26 2 0
8 12 1 0
27 28 1 0
1 2 1 0
12 13 1 0
1 4 1 0
13 14 1 0
25 30 1 0
26 29 1 0
29 27 2 0
28 30 2 0
2 3 1 0
27 31 1 0
13 15 2 0
31 32 1 0
3 6 1 0
31 33 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 481.56Molecular Weight (Monoisotopic): 481.0766AlogP: 4.25#Rotatable Bonds: 6Polar Surface Area: 136.36Molecular Species: ACIDHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.49CX Basic pKa: ┄CX LogP: 4.60CX LogD: 1.68Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.48Np Likeness Score: -2.17
References 1. Podvinec M, Lim SP, Schmidt T, Scarsi M, Wen D, Sonntag LS, Sanschagrin P, Shenkin PS, Schwede T.. (2010) Novel inhibitors of dengue virus methyltransferase: discovery by in vitro-driven virtual screening on a desktop computer grid., 53 (4): [PMID:20108931 ] [10.1021/jm900776m ] 2. PubChem BioAssay data set,