(S)-N-(3-(furan-2-yl)-3-phenylpropyl)-N-(4-methoxybenzyl)furan-3-carboxamide

ID: ALA606173

PubChem CID: 2185920

Max Phase: Preclinical

Molecular Formula: C26H25NO4

Molecular Weight: 415.49

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: ZINC 02826899 | CHEMBL606173|ZINC 02826899|BDBM50481406

Canonical SMILES:  COc1ccc(CN(CC[C@@H](c2ccccc2)c2ccco2)C(=O)c2ccoc2)cc1

Standard InChI:  InChI=1S/C26H25NO4/c1-29-23-11-9-20(10-12-23)18-27(26(28)22-14-17-30-19-22)15-13-24(25-8-5-16-31-25)21-6-3-2-4-7-21/h2-12,14,16-17,19,24H,13,15,18H2,1H3/t24-/m0/s1

Standard InChI Key:  KKPUZWPGDJLPSY-DEOSSOPVSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    7.5510   -2.5234    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5454   -3.6363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1951   -3.0130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3355   -1.5323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8033   -1.2230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8925   -3.7584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8883   -4.9584    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6003    1.4977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6387    0.8962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2925   -3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0048   -2.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3074   -3.7403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6048   -2.9858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3127   -5.2411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6133   -5.9885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6165   -7.4885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3190   -8.2412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0184   -7.4940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0152   -5.9940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9594   -3.5998    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9573   -2.4798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2005   -1.1847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7349   -1.5043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6  7  1  0
 13 15  1  0
  2  3  2  0
 15 16  1  0
  6  8  2  0
  7 17  1  0
  3  4  1  0
 17 18  1  0
  7  9  1  0
  4  5  2  0
 20 18  1  1
  9 10  1  0
 20 21  1  0
  5  1  1  0
 20 22  1  0
 10 11  2  0
 22 23  2  0
  1  2  1  0
 23 24  1  0
 11 12  1  0
 24 25  2  0
  3  6  1  0
 25 26  1  0
 12 13  2  0
 26 27  2  0
 27 22  1  0
 21 28  1  0
 13 14  1  0
 14 19  2  0
 19 10  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 21  2  0
M  END

Associated Targets(non-human)

Genome polyprotein (78 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 415.49Molecular Weight (Monoisotopic): 415.1784AlogP: 5.75#Rotatable Bonds: 9
Polar Surface Area: 55.82Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.84CX LogD: 4.84
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.35Np Likeness Score: -0.98

References

1. Podvinec M, Lim SP, Schmidt T, Scarsi M, Wen D, Sonntag LS, Sanschagrin P, Shenkin PS, Schwede T..  (2010)  Novel inhibitors of dengue virus methyltransferase: discovery by in vitro-driven virtual screening on a desktop computer grid.,  53  (4): [PMID:20108931] [10.1021/jm900776m]

Source