(R)-4-(2,5-dimethylbenzoyl)-3-hydroxy-5-(4-hydroxyphenyl)-1-phenethyl-1H-pyrrol-2(5H)-one

ID: ALA606193

PubChem CID: 46233561

Max Phase: Preclinical

Molecular Formula: C27H25NO4

Molecular Weight: 427.50

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(C)c(C(=O)C2=C(O)C(=O)N(CCc3ccccc3)[C@@H]2c2ccc(O)cc2)c1

Standard InChI:  InChI=1S/C27H25NO4/c1-17-8-9-18(2)22(16-17)25(30)23-24(20-10-12-21(29)13-11-20)28(27(32)26(23)31)15-14-19-6-4-3-5-7-19/h3-13,16,24,29,31H,14-15H2,1-2H3/t24-/m1/s1

Standard InChI Key:  SVWUVFBDHGEBNF-XMMPIXPASA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0031   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3039   -3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3070   -5.2502    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5205   -6.1100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0570   -7.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5570   -7.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0935   -6.1100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6596   -5.7324    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7624   -8.5074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3310   -5.6378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5226   -6.5403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0900   -4.4683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8937   -3.5634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9044   -5.9567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5118   -4.1469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1954   -4.0014    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3261   -8.7469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2806  -10.1196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5193   -8.6186    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7723  -10.2775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3815  -11.6482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4990  -12.8612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0073  -12.7034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6019  -11.3326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7952  -11.2064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5748  -11.7745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  4  2  0
 13 16  1  1
 16 17  2  0
  7  8  1  0
 18 19  1  0
  8  9  1  0
  9 10  1  0
  4  5  1  0
 16 21  1  0
 17 20  1  0
 20 18  2  0
 19 21  2  0
  2  3  1  0
 18 22  1  0
  5  6  2  0
 12 23  1  0
  6  1  1  0
 23 24  1  0
 10 11  1  0
 23 25  2  0
 11 12  2  0
 24 26  2  0
 12 13  1  0
 26 27  1  0
 13  9  1  0
 27 28  2  0
  1  2  2  0
 28 29  1  0
 10 14  2  0
 29 30  2  0
 30 24  1  0
  2  7  1  0
 30 31  1  0
 11 15  1  0
 27 32  1  0
M  END

Associated Targets(non-human)

Genome polyprotein (78 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 427.50Molecular Weight (Monoisotopic): 427.1784AlogP: 4.83#Rotatable Bonds: 6
Polar Surface Area: 77.84Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.34CX Basic pKa: CX LogP: 4.99CX LogD: 4.98
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.55Np Likeness Score: -0.89

References

1. Podvinec M, Lim SP, Schmidt T, Scarsi M, Wen D, Sonntag LS, Sanschagrin P, Shenkin PS, Schwede T..  (2010)  Novel inhibitors of dengue virus methyltransferase: discovery by in vitro-driven virtual screening on a desktop computer grid.,  53  (4): [PMID:20108931] [10.1021/jm900776m]

Source