The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Amino-4-{1-[5-(6-amino-1,6-dihydro-purin-9-yl)-3,4-dihydroxy-tetrahydro-furan-2-yl]-2-aminotriphosphoric acid-ethylsulfanyl}-butyric acid ID: ALA606493
PubChem CID: 46874059
Max Phase: Preclinical
Molecular Formula: C15H28N7O14P3S
Molecular Weight: 655.41
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: NC(CCS[C@@H](CNP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H]1OC(n2cnc3c2NC=NC3N)[C@H](O)[C@@H]1O)C(=O)O
Standard InChI: InChI=1S/C15H28N7O14P3S/c16-6(15(25)26)1-2-40-7(3-21-37(27,28)35-39(32,33)36-38(29,30)31)11-9(23)10(24)14(34-11)22-5-20-8-12(17)18-4-19-13(8)22/h4-7,9-12,14,23-24H,1-3,16-17H2,(H,18,19)(H,25,26)(H,32,33)(H2,21,27,28)(H2,29,30,31)/t6?,7-,9-,10+,11+,12?,14?/m0/s1
Standard InChI Key: VWAGXKALHCKPTB-OXTAHZRQSA-N
Molfile:
RDKit 2D
41 43 0 0 0 0 0 0 0 0999 V2000
6.8750 -3.3167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3792 -3.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8625 -4.6250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3792 -2.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3917 -1.3417 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
6.8792 -2.3125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5750 -5.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0917 -4.2542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5167 -2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3292 -4.6250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3917 -2.1250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4292 -0.6250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3917 -2.8417 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
5.6167 -5.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4292 0.3125 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
7.9000 -3.4417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4292 -2.5167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8875 -2.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4292 -3.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7667 -4.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0792 -3.4042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6125 -4.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6417 -1.3417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6542 -3.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0250 -2.8750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5250 0.3125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1500 -1.3125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0417 -4.0292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9417 -5.8042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7250 -4.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5542 -2.8417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4292 1.3125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1792 0.2208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2417 -5.8125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3125 -4.8167 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.8875 -1.6042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0667 -3.8375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2667 -5.2042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2917 -5.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7417 -4.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2737 -3.6265 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 2 2 0
5 11 1 0
6 9 2 0
7 3 1 0
8 3 1 0
9 1 1 0
10 8 1 0
11 13 1 0
12 5 1 0
13 21 1 0
14 7 1 0
15 12 1 0
16 2 1 0
17 19 2 0
18 4 1 0
19 16 1 0
10 20 1 0
21 24 1 0
22 30 1 0
23 5 2 0
20 24 1 1
25 13 2 0
26 15 2 0
27 5 1 0
28 22 2 0
7 29 1 6
30 39 1 0
31 13 1 0
32 15 1 0
33 15 1 0
14 34 1 6
20 35 1 0
36 18 1 0
37 22 1 0
38 30 1 0
39 40 1 0
40 35 1 0
6 4 1 0
14 10 1 0
17 18 1 0
10 41 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 655.41Molecular Weight (Monoisotopic): 655.0628AlogP: -2.27#Rotatable Bonds: 14Polar Surface Area: 343.86Molecular Species: ZWITTERIONHBA: 16HBD: 11#RO5 Violations: 3HBA (Lipinski): 21HBD (Lipinski): 13#RO5 Violations (Lipinski): 3CX Acidic pKa: 0.86CX Basic pKa: 9.50CX LogP: -10.10CX LogD: -14.53Aromatic Rings: 1Heavy Atoms: 40QED Weighted: 0.09Np Likeness Score: 1.11
References 1. Kappler F, Vrudhula VM, Hampton A.. (1987) Isozyme-specific enzyme inhibitors. 14. 5'(R)-C-[(L-homocystein-S-yl)methyl]adenosine 5'-(beta,gamma-imidotriphosphate), a potent inhibitor of rat methionine adenosyltransferases., 30 (9): [PMID:3498043 ] [10.1021/jm00392a013 ]