The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[1-((S)-(S)-4-Benzoyl-6-(S)-oxo-hexahydro-pyrrolo[3,2-c]pyrazole-1-carbonyl)-3-methyl-butyl]-4-tert-butyl-benzamide ID: ALA607122
PubChem CID: 11443502
Max Phase: Preclinical
Molecular Formula: C29H36N4O4
Molecular Weight: 504.63
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@H](NC(=O)c1ccc(C(C)(C)C)cc1)C(=O)N1NC[C@@H]2[C@H]1C(=O)CN2C(=O)c1ccccc1
Standard InChI: InChI=1S/C29H36N4O4/c1-18(2)15-22(31-26(35)19-11-13-21(14-12-19)29(3,4)5)28(37)33-25-23(16-30-33)32(17-24(25)34)27(36)20-9-7-6-8-10-20/h6-14,18,22-23,25,30H,15-17H2,1-5H3,(H,31,35)/t22-,23+,25-/m0/s1
Standard InChI Key: KHXWGZGVODXABJ-ARNLJNQMSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
4.1250 -3.2917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1792 -3.3375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8792 -3.6250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4292 -3.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4125 -3.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3000 -4.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2042 -2.4667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9000 -2.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1000 -4.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7000 -3.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0125 -2.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2667 -3.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9875 -3.7125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5625 -3.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4125 -4.5292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9625 -5.0917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9000 -2.1042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5875 -4.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8750 -4.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6125 -3.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7000 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2625 -2.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5625 -4.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1625 -3.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1625 -4.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8750 -3.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2750 -1.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3000 -5.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0000 -4.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1833 -5.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3250 -2.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6125 -4.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4500 -1.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6875 -1.0375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0375 -3.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3250 -4.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0375 -4.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 2 1 1
3 1 1 0
4 3 1 0
5 1 1 0
3 6 1 1
7 1 1 0
8 2 1 0
9 6 1 0
10 5 1 0
11 7 1 0
12 13 1 0
13 10 1 0
14 12 1 0
15 5 2 0
16 6 2 0
17 8 2 0
18 19 1 0
19 26 2 0
20 8 1 0
10 21 1 1
22 12 2 0
23 14 1 0
24 14 2 0
25 23 2 0
26 24 1 0
27 21 1 0
28 18 1 0
29 18 1 0
30 18 1 0
31 20 1 0
32 20 2 0
33 27 1 0
34 27 1 0
35 31 2 0
36 32 1 0
37 36 2 0
4 11 1 0
2 9 1 0
25 19 1 0
35 37 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 504.63Molecular Weight (Monoisotopic): 504.2737AlogP: 2.94#Rotatable Bonds: 6Polar Surface Area: 98.82Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.07CX LogP: 3.95CX LogD: 3.95Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.63Np Likeness Score: -0.60
References 1. Wang Y, Benn A, Flinn N, Monk T, Ramjee M, Watts J, Quibell M.. (2005) cis-6-oxo-hexahydro-2-oxa-1,4-diazapentalene and cis-6-oxo-hexahydropyrrolo[3,2-c]pyrazole based scaffolds: design rationale, synthesis and cysteinyl proteinase inhibition., 15 (5): [PMID:15713380 ] [10.1016/j.bmcl.2005.01.022 ]