The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-(N-Triphosphoamino)ethyl)-5-(6-amino-purin-9-yl)-tetrahydro-furan-3,4-diol ID: ALA607665
PubChem CID: 46877015
Max Phase: Preclinical
Molecular Formula: C11H19N6O12P3
Molecular Weight: 520.23
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ncnc2c1ncn2C1O[C@H](CCNP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O
Standard InChI: InChI=1S/C11H19N6O12P3/c12-9-6-10(14-3-13-9)17(4-15-6)11-8(19)7(18)5(27-11)1-2-16-30(20,21)28-32(25,26)29-31(22,23)24/h3-5,7-8,11,18-19H,1-2H2,(H,25,26)(H2,12,13,14)(H2,16,20,21)(H2,22,23,24)/t5-,7-,8-,11?/m1/s1
Standard InChI Key: ZDLODJLDLLIFLF-YNJARDAQSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
6.2917 -4.4292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2875 -5.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0042 -1.2292 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
7.0792 -4.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0792 -3.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2917 -3.1000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0292 -6.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8125 -3.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6167 -4.7667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2167 -2.0292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7875 -0.4292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4375 -2.8292 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
3.5667 0.3708 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
5.2042 -6.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9542 -5.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7917 -2.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7917 -4.5917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5042 -3.3500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7167 -0.8167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5042 -4.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1500 -2.4167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3667 0.5833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6042 -3.6417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2042 -1.4417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5125 -6.7042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6375 -3.0417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7667 0.1583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3542 1.1708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1667 -5.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7875 -2.1125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7125 -6.7042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9917 -4.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 10 1 0
4 1 1 0
5 4 2 0
6 8 2 0
7 2 1 0
8 1 1 0
9 2 1 0
10 12 1 0
11 3 1 0
12 23 1 0
13 11 1 0
14 7 1 0
15 9 1 0
16 5 1 0
17 4 1 0
18 20 1 0
19 3 2 0
20 17 2 0
21 12 2 0
22 13 2 0
23 32 1 0
24 3 1 0
7 25 1 6
26 12 1 0
27 13 1 0
28 13 1 0
15 29 1 1
30 16 1 0
14 31 1 6
32 29 1 0
6 5 1 0
14 15 1 0
16 18 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 520.23Molecular Weight (Monoisotopic): 520.0274AlogP: -1.67#Rotatable Bonds: 9Polar Surface Area: 281.93Molecular Species: ACIDHBA: 13HBD: 8#RO5 Violations: 3HBA (Lipinski): 18HBD (Lipinski): 9#RO5 Violations (Lipinski): 3CX Acidic pKa: 1.06CX Basic pKa: 4.97CX LogP: -5.92CX LogD: -11.10Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.17Np Likeness Score: 1.29
References 1. Vrudhula VM, Kappler F, Hampton A.. (1987) Isozyme-specific enzyme inhibitors. 13. S-[5'(R)-[(N-triphosphoamino)methyl]adenosyl]-L-homocysteine, a potent inhibitor of rat methionine adenosyltransferases., 30 (5): [PMID:3572977 ] [10.1021/jm00388a024 ]