3-(4-{[6-Amino-9-(3,4-dihydroxy-5-hydroxymethyl-tetrahydro-furan-2-yl)-9H-purin-2-yl]-hydrazonomethyl}-phenyl)-propionic acid tert-butyl ester

ID: ALA607886

Max Phase: Preclinical

Molecular Formula: C24H31N7O6

Molecular Weight: 513.56

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CC(C)(C)OC(=O)CCc1ccc(/C=N/Nc2nc(N)c3ncn(C4O[C@H](CO)[C@@H](O)[C@H]4O)c3n2)cc1

Standard InChI:  InChI=1S/C24H31N7O6/c1-24(2,3)37-16(33)9-8-13-4-6-14(7-5-13)10-27-30-23-28-20(25)17-21(29-23)31(12-26-17)22-19(35)18(34)15(11-32)36-22/h4-7,10,12,15,18-19,22,32,34-35H,8-9,11H2,1-3H3,(H3,25,28,29,30)/b27-10+/t15-,18-,19-,22?/m1/s1

Standard InChI Key:  RJSQEVVKXNEOSR-YIBDIUPLSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
    6.7250   -2.5417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9667   -2.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7042   -4.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9667   -1.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2750   -2.7042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7167   -1.2625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4625   -5.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1917   -1.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5917   -1.5167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0667   -3.9292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2750   -1.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5917   -2.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6667   -5.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4292   -4.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2167   -2.3000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4125    0.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9000   -2.7042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1250   -0.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4167    1.0458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9542   -5.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2667   -0.3250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8417    0.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5292   -2.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1667   -5.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3083   -0.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8167   -2.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4000   -1.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4250   -3.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3125   -1.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8292   -1.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1042   -2.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1167   -1.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3917   -2.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6292   -3.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5542   -0.2125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8500    1.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5542    0.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  2  1  0
  5  2  2  0
  6  8  2  0
  7  3  1  0
  8  1  1  0
  9 12  2  0
 10  3  1  0
 11  4  2  0
 12  5  1  0
 13  7  1  0
 14 10  1  0
 15 17  1  0
 16 25  1  0
 17 12  1  0
 18 16  1  0
 19 16  2  0
  7 20  1  6
 21 11  1  0
 22 18  1  0
 23 15  2  0
 13 24  1  6
 25 29  1  0
 26 23  1  0
 27 33  1  0
 14 28  1  1
 29 27  1  0
 30 26  2  0
 31 26  1  0
 32 30  1  0
 33 31  2  0
 34 28  1  0
 35 22  1  0
 36 22  1  0
 37 22  1  0
  6  4  1  0
 14 13  1  0
 11  9  1  0
 32 27  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA607886

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 513.56

Molecular Weight (Monoisotopic): 513.2336

AlogP: 0.74

#Rotatable Bonds: 8

Polar Surface Area: 190.23

Molecular Species: NEUTRAL

HBA: 13

HBD: 5

#RO5 Violations: 2

HBA (Lipinski): 13

HBD (Lipinski): 6

#RO5 Violations (Lipinski): 3

CX Acidic pKa: 11.74

CX Basic pKa: 4.68

CX LogP: 1.70

CX LogD: 1.68

Aromatic Rings: 3

Heavy Atoms: 37

QED Weighted: 0.16

Np Likeness Score: 0.02

References

1. Niiya K, Thompson RD, Silvia SK, Olsson RA..  (1992)  2-(N'-aralkylidenehydrazino)adenosines: potent and selective coronary vasodilators.,  35  (24): [PMID:1469688] [10.1021/jm00102a008]

Source

Source(1):

• Scientific Literature