2-Amino-4-{2-(N-triphosphoamino)-1-[5-(6-amino-purin-9-yl)-3,4-dihydroxy-tetrahydro-furan-2-yl]-ethylsulfanyl}-butyric acid

ID: ALA609078

PubChem CID: 46877039

Max Phase: Preclinical

Molecular Formula: C15H26N7O14P3S

Molecular Weight: 653.40

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1ncnc2c1ncn2C1O[C@H]([C@H](CNP(=O)(O)OP(=O)(O)OP(=O)(O)O)SCCC(N)C(=O)O)[C@@H](O)[C@H]1O

Standard InChI:  InChI=1S/C15H26N7O14P3S/c16-6(15(25)26)1-2-40-7(3-21-37(27,28)35-39(32,33)36-38(29,30)31)11-9(23)10(24)14(34-11)22-5-20-8-12(17)18-4-19-13(8)22/h4-7,9-11,14,23-24H,1-3,16H2,(H,25,26)(H,32,33)(H2,17,18,19)(H2,21,27,28)(H2,29,30,31)/t6?,7-,9-,10+,11+,14?/m0/s1

Standard InChI Key:  CISDHKHIEKDPHJ-SJAFKOQPSA-N

Molfile:  

     RDKit          2D

 41 43  0  0  0  0  0  0  0  0999 V2000
    7.2917   -4.8042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2875   -5.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0042   -1.6042    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    8.0792   -4.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0792   -3.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2917   -3.4750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0292   -6.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6167   -5.1417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8125   -4.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9542   -5.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2167   -2.4042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7875   -0.8042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4375   -3.2042    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    6.2042   -6.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5667   -0.0042    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    8.7917   -3.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7917   -4.9667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5042   -3.7250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1667   -5.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6042   -4.0167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1917   -5.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7167   -1.1917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5042   -4.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9917   -4.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1500   -2.7917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3667    0.2083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2042   -1.8167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8167   -4.6125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5125   -7.0792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3750   -5.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6375   -3.4167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7667   -0.2167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3542    0.7958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7125   -7.0792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5542   -5.9292    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.7875   -2.4875    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4167   -4.9042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7625   -6.5250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1542   -6.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7667   -5.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7938   -4.6421    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3 11  1  0
  4  1  1  0
  5  4  2  0
  6  9  2  0
  7  2  1  0
  8  2  1  0
  9  1  1  0
 10  8  1  0
 11 13  1  0
 12  3  1  0
 13 20  1  0
 14  7  1  0
 15 12  1  0
 16  5  1  0
 17  4  1  0
 18 23  1  0
 10 19  1  0
 20 24  1  0
 21 30  1  0
 22  3  2  0
 23 17  2  0
 19 24  1  1
 25 13  2  0
 26 15  2  0
 27  3  1  0
 28 21  2  0
  7 29  1  6
 30 39  1  0
 31 13  1  0
 32 15  1  0
 33 15  1  0
 14 34  1  6
 19 35  1  0
 36 16  1  0
 37 21  1  0
 38 30  1  0
 39 40  1  0
 40 35  1  0
  6  5  1  0
 14 10  1  0
 16 18  2  0
 10 41  1  6
M  END

Associated Targets(non-human)

Mat1a S-adenosylmethionine synthetase (MAT 1 and MAT 2) (155 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 653.40Molecular Weight (Monoisotopic): 653.0471AlogP: -2.15#Rotatable Bonds: 14
Polar Surface Area: 345.25Molecular Species: ZWITTERIONHBA: 16HBD: 10
#RO5 Violations: 3HBA (Lipinski): 21HBD (Lipinski): 12#RO5 Violations (Lipinski): 3
CX Acidic pKa: 1.05CX Basic pKa: 9.50CX LogP: -8.52CX LogD: -13.85
Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.10Np Likeness Score: 1.09

References

1. Vrudhula VM, Kappler F, Hampton A..  (1987)  Isozyme-specific enzyme inhibitors. 13. S-[5'(R)-[(N-triphosphoamino)methyl]adenosyl]-L-homocysteine, a potent inhibitor of rat methionine adenosyltransferases.,  30  (5): [PMID:3572977] [10.1021/jm00388a024]

Source