The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3,4-Dihydroxy-5-(6-{3-[4-(pyrimidin-2-ylsulfamoyl)-phenyl]-ureido}-purin-9-yl)-tetrahydro-furan-2-carboxylic acid ethylamide ID: ALA609340
PubChem CID: 46876760
Max Phase: Preclinical
Molecular Formula: C23H24N10O7S
Molecular Weight: 584.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCNC(=O)[C@@H]1OC(n2cnc3c(NC(=O)Nc4ccc(S(=O)(=O)Nc5ncccn5)cc4)ncnc32)[C@@H](O)[C@H]1O
Standard InChI: InChI=1S/C23H24N10O7S/c1-2-24-20(36)17-15(34)16(35)21(40-17)33-11-29-14-18(27-10-28-19(14)33)31-23(37)30-12-4-6-13(7-5-12)41(38,39)32-22-25-8-3-9-26-22/h3-11,15-17,21,34-35H,2H2,1H3,(H,24,36)(H,25,26,32)(H2,27,28,30,31,37)/t15-,16+,17-,21?/m1/s1
Standard InChI Key: QRRCPELOVIBHAK-IJIRQLBGSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
4.0792 -6.3375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3000 -7.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8875 -2.3625 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.3000 -6.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3000 -5.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5667 -7.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0792 -5.0042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3125 -7.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0875 -6.8792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5625 -5.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0917 -8.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5875 -4.8500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6125 -1.9500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5875 -4.0250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3000 -3.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3375 -2.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3917 -7.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5875 -6.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8667 -5.2625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1625 -2.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4750 -1.6375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3042 -3.0875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0125 -4.0250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8667 -6.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3375 -3.1917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0500 -1.9500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3000 -2.7792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8042 -6.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6417 -8.4542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1625 -3.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4417 -2.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8042 -8.2625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3542 -8.9917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7292 -3.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7292 -2.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4500 -4.0250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7667 -3.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0500 -3.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7667 -2.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6375 -8.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0500 -7.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 20 1 0
4 1 1 0
5 4 1 0
6 9 1 0
7 10 2 0
8 2 1 0
9 2 1 0
10 1 1 0
11 8 1 0
12 5 2 0
13 3 1 0
14 12 1 0
15 14 1 0
16 13 1 0
6 17 1 1
18 4 2 0
19 24 2 0
20 30 1 0
21 3 2 0
22 3 2 0
23 15 1 0
24 18 1 0
25 16 1 0
26 16 2 0
27 15 2 0
28 17 2 0
8 29 1 6
30 36 2 0
31 35 1 0
32 17 1 0
11 33 1 6
34 23 1 0
35 34 2 0
36 34 1 0
37 39 2 0
38 25 2 0
39 26 1 0
40 32 1 0
41 40 1 0
5 7 1 0
6 11 1 0
19 12 1 0
31 20 2 0
37 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 584.58Molecular Weight (Monoisotopic): 584.1550AlogP: -0.18#Rotatable Bonds: 8Polar Surface Area: 235.47Molecular Species: NEUTRALHBA: 13HBD: 6#RO5 Violations: 3HBA (Lipinski): 17HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 6.88CX Basic pKa: 2.15CX LogP: -0.78CX LogD: -1.28Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.16Np Likeness Score: -0.84
References 1. González MP, Terán C, Teijeira M, Besada P, González-Moa MJ.. (2005) BCUT descriptors to predicting affinity toward A3 adenosine receptors., 15 (15): [PMID:15990306 ] [10.1016/j.bmcl.2005.05.122 ] 2. González MP, Terán C, Teijeira M, Besada P.. (2005) Geometry, topology, and atom-weights assembly descriptors to predicting A1 adenosine receptors agonists., 15 (10): [PMID:15863334 ] [10.1016/j.bmcl.2005.03.028 ]