2-(6-Benzylsulfanyl-8-pyrrolidin-1-yl-purin-9-yl)-5-hydroxymethyl-tetrahydro-furan-3,4-diol

ID: ALA609376

PubChem CID: 46877164

Max Phase: Preclinical

Molecular Formula: C21H25N5O4S

Molecular Weight: 443.53

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  OC[C@H]1OC(n2c(N3CCCC3)nc3c(SCc4ccccc4)ncnc32)[C@H](O)[C@@H]1O

Standard InChI:  InChI=1S/C21H25N5O4S/c27-10-14-16(28)17(29)20(30-14)26-18-15(24-21(26)25-8-4-5-9-25)19(23-12-22-18)31-11-13-6-2-1-3-7-13/h1-3,6-7,12,14,16-17,20,27-29H,4-5,8-11H2/t14-,16-,17-,20?/m1/s1

Standard InChI Key:  DUACVZOIDOBZNS-FIALEDGQSA-N

Molfile:  

     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
    0.1250   -0.4625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6000    0.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1167   -1.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6583   -0.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1167    0.8500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6583    0.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1375   -2.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5458   -1.4625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9500   -2.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4167    0.2000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2083   -1.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3583    0.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3583   -0.6292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0625    0.5833    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3625    1.8000    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0583   -0.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3500   -3.3875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4375   -3.3917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6625    2.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2083   -1.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9375   -0.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8792    0.8833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1500    2.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0208   -1.1292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5500    1.5083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5417    2.9083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6667    0.6708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7042   -0.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3542    1.5083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3500    2.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7625    2.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  1  1  0
  5  2  2  0
  6  4  2  0
  7  3  1  0
  8  3  1  0
  9  7  1  0
 10  2  1  0
 11  8  1  0
 12  6  1  0
 13  4  1  0
 14 16  1  0
 15 12  1  0
 16 13  2  0
  7 17  1  6
  9 18  1  6
 19 15  1  0
 11 20  1  1
 21 10  1  0
 22 10  1  0
 23 19  1  0
 24 20  1  0
 25 23  2  0
 26 23  1  0
 27 22  1  0
 28 21  1  0
 29 25  1  0
 30 26  2  0
 31 30  1  0
  6  5  1  0
 11  9  1  0
 12 14  2  0
 28 27  1  0
 29 31  2  0
M  END

Associated Targets(Human)

SLC29A1 Tclin Equilibrative nucleoside transporter 1 (1711 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 443.53Molecular Weight (Monoisotopic): 443.1627AlogP: 1.33#Rotatable Bonds: 6
Polar Surface Area: 116.76Molecular Species: NEUTRALHBA: 10HBD: 3
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.45CX Basic pKa: 2.76CX LogP: 2.18CX LogD: 2.18
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.38Np Likeness Score: -0.39

References

1. Tromp RA, Spanjersberg RF, von Frijtag Drabbe Künzel JK, IJzerman AP..  (2005)  Inhibition of nucleoside transport proteins by C8-alkylamine-substituted purines.,  48  (1): [PMID:15634027] [10.1021/jm049303k]

Source