The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(6-Benzylsulfanyl-8-propylamino-purin-9-yl)-5-hydroxymethyl-tetrahydro-furan-3,4-diol ID: ALA609378
PubChem CID: 46877166
Max Phase: Preclinical
Molecular Formula: C20H25N5O4S
Molecular Weight: 431.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCNc1nc2c(SCc3ccccc3)ncnc2n1C1O[C@H](CO)[C@@H](O)[C@H]1O
Standard InChI: InChI=1S/C20H25N5O4S/c1-2-8-21-20-24-14-17(25(20)19-16(28)15(27)13(9-26)29-19)22-11-23-18(14)30-10-12-6-4-3-5-7-12/h3-7,11,13,15-16,19,26-28H,2,8-10H2,1H3,(H,21,24)/t13-,15-,16-,19?/m1/s1
Standard InChI Key: SQDWHYNKFJICLC-XAUNWSGPSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
0.1792 -0.5542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6625 0.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1792 -2.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6000 -0.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1792 0.7833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6125 0.5208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0833 -2.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5000 -1.5750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9125 -2.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1625 -2.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3208 0.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3208 -0.7167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0375 0.5208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3208 1.7583 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.0375 -0.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4875 0.1250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4042 -3.5250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4125 -3.5167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6208 2.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1625 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2042 2.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9958 -1.2292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9000 0.8458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6167 1.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6167 2.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7250 0.8458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1375 1.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4375 1.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4250 2.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8417 2.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 1 1 0
5 2 2 0
6 4 2 0
7 3 1 0
8 3 1 0
9 7 1 0
10 8 1 0
11 6 1 0
12 4 1 0
13 15 1 0
14 11 1 0
15 12 2 0
16 2 1 0
7 17 1 6
9 18 1 6
19 14 1 0
10 20 1 1
21 19 1 0
22 20 1 0
23 16 1 0
24 21 2 0
25 21 1 0
26 23 1 0
27 26 1 0
28 24 1 0
29 25 2 0
30 29 1 0
6 5 1 0
10 9 1 0
11 13 2 0
28 30 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.52Molecular Weight (Monoisotopic): 431.1627AlogP: 1.55#Rotatable Bonds: 8Polar Surface Area: 125.55Molecular Species: NEUTRALHBA: 10HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.45CX Basic pKa: 2.77CX LogP: 2.02CX LogD: 2.02Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.31Np Likeness Score: -0.31
References 1. Tromp RA, Spanjersberg RF, von Frijtag Drabbe Künzel JK, IJzerman AP.. (2005) Inhibition of nucleoside transport proteins by C8-alkylamine-substituted purines., 48 (1): [PMID:15634027 ] [10.1021/jm049303k ]