2-(6-Benzylsulfanyl-8-pentylamino-purin-9-yl)-5-hydroxymethyl-tetrahydro-furan-3,4-diol

ID: ALA610047

PubChem CID: 46877189

Max Phase: Preclinical

Molecular Formula: C22H29N5O4S

Molecular Weight: 459.57

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCNc1nc2c(SCc3ccccc3)ncnc2n1C1O[C@H](CO)[C@@H](O)[C@H]1O

Standard InChI:  InChI=1S/C22H29N5O4S/c1-2-3-7-10-23-22-26-16-19(27(22)21-18(30)17(29)15(11-28)31-21)24-13-25-20(16)32-12-14-8-5-4-6-9-14/h4-6,8-9,13,15,17-18,21,28-30H,2-3,7,10-12H2,1H3,(H,23,26)/t15-,17-,18-,21?/m1/s1

Standard InChI Key:  WJQWAYAXBWACGA-GWRCBPMCSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   -0.0750   -0.6792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4042   -0.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0833   -2.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8625   -0.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0833    0.6625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8708    0.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3458   -2.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7583   -1.6917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1708   -2.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4208   -2.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5833    0.8083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5750   -0.8417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2958    0.3958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5833    1.6333    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2958   -0.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2292    0.0083    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1417   -3.6417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6708   -3.6417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8750    2.0458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4250   -1.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0500    2.0458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2500   -1.3542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6417    0.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3542    1.3333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3542    2.7583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4667    0.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7000    1.4458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8750    1.4458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1042    2.1708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1792    1.3333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1667    2.7583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5875    2.0458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  1  1  0
  5  2  2  0
  6  4  2  0
  7  3  1  0
  8  3  1  0
  9  7  1  0
 10  8  1  0
 11  6  1  0
 12  4  1  0
 13 15  1  0
 14 11  1  0
 15 12  2  0
 16  2  1  0
  7 17  1  6
  9 18  1  6
 19 14  1  0
 10 20  1  1
 21 19  1  0
 22 20  1  0
 23 16  1  0
 24 21  2  0
 25 21  1  0
 26 23  1  0
 27 28  1  0
 28 26  1  0
 29 27  1  0
 30 24  1  0
 31 25  2  0
 32 31  1  0
  6  5  1  0
 10  9  1  0
 11 13  2  0
 30 32  2  0
M  END

Associated Targets(Human)

SLC29A1 Tclin Equilibrative nucleoside transporter 1 (1711 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 459.57Molecular Weight (Monoisotopic): 459.1940AlogP: 2.33#Rotatable Bonds: 10
Polar Surface Area: 125.55Molecular Species: NEUTRALHBA: 10HBD: 4
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 12.45CX Basic pKa: 2.77CX LogP: 2.91CX LogD: 2.91
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.21Np Likeness Score: -0.22

References

1. Tromp RA, Spanjersberg RF, von Frijtag Drabbe Künzel JK, IJzerman AP..  (2005)  Inhibition of nucleoside transport proteins by C8-alkylamine-substituted purines.,  48  (1): [PMID:15634027] [10.1021/jm049303k]

Source