[6-Isothiocyanato-1-(2-morpholin-4-yl-ethyl)-1H-indol-3-yl]-naphthalen-1-yl-methanone

ID: ALA61448

PubChem CID: 9980752

Max Phase: Preclinical

Molecular Formula: C26H23N3O2S

Molecular Weight: 441.56

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(c1cccc2ccccc12)c1cn(CCN2CCOCC2)c2cc(N=C=S)ccc12

Standard InChI:  InChI=1S/C26H23N3O2S/c30-26(23-7-3-5-19-4-1-2-6-21(19)23)24-17-29(11-10-28-12-14-31-15-13-28)25-16-20(27-18-32)8-9-22(24)25/h1-9,16-17H,10-15H2

Standard InChI Key:  LBSVQGQJTYJQKW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    0.5792   -2.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5792   -3.3417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9375   -2.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0042   -2.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7542   -1.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0042   -3.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3417   -1.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0750   -3.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7500   -2.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5208   -3.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5208   -2.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5500   -4.6042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5583   -3.4625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5948   -2.8607    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.7750   -3.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3542   -1.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0333   -3.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9250   -5.7417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3292   -1.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3625   -4.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0333   -2.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5250   -1.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1292   -4.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1500   -5.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5667   -2.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1042   -0.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3167   -5.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3375   -5.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5167   -1.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7292   -2.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9667   -3.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5542   -2.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  1  2  0
  4  1  1  0
  5  1  1  0
  6  4  1  0
  7  5  1  0
  8 13  2  0
  9  7  2  0
 10  6  2  0
 11  4  2  0
 12 20  1  0
 13 17  1  0
 14  8  2  0
 15  2  1  0
 16  5  2  0
 17 21  2  0
 18 28  1  0
 19  9  1  0
 20 15  1  0
 21 11  1  0
 22  7  1  0
 23 12  1  0
 24 12  1  0
 25  9  1  0
 26 22  2  0
 27 23  1  0
 28 24  1  0
 29 26  1  0
 30 19  1  0
 31 25  2  0
 32 31  1  0
  2  6  1  0
 17 10  1  0
 29 19  2  0
 30 32  2  0
 18 27  1  0
M  END

Associated Targets(non-human)

Adcy5 Adenylate cyclase type V (89 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Cnr1 Cannabinoid CB1 receptor (3458 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 441.56Molecular Weight (Monoisotopic): 441.1511AlogP: 5.09#Rotatable Bonds: 6
Polar Surface Area: 46.83Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 6.28CX LogP: 5.57CX LogD: 5.54
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.24Np Likeness Score: -1.26

References

1. Yamada K, Rice KC, Flippen-Anderson JL, Eissenstat MA, Ward SJ, Johnson MR, Howlett AC..  (1996)  (Aminoalkyl)indole isothiocyanates as potential electrophilic affinity ligands for the brain cannabinoid receptor.,  39  (10): [PMID:8642555] [10.1021/jm950932r]

Source