The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3,3,3',3'-tetramethyl-1,1'-spirobi(indan)-6,6'-dihydroxy-5,7'-bisurea ID: ALA62411
PubChem CID: 478347
Max Phase: Preclinical
Molecular Formula: C23H28N4O4
Molecular Weight: 424.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)CC2(CC(C)(C)c3ccc(O)c(NC(N)=O)c32)c2cc(O)c(NC(N)=O)cc21
Standard InChI: InChI=1S/C23H28N4O4/c1-21(2)9-23(17-11(21)5-6-15(28)18(17)27-20(25)31)10-22(3,4)12-7-14(26-19(24)30)16(29)8-13(12)23/h5-8,28-29H,9-10H2,1-4H3,(H3,24,26,30)(H3,25,27,31)
Standard InChI Key: NBQYMXISJVPDAX-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
4.8375 -2.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6625 -2.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0125 -2.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0667 -1.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6042 -1.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0667 -3.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1875 -1.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8292 -1.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8542 -3.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8292 -3.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6000 -3.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3625 -2.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7792 -1.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6542 -0.9917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0625 -0.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1292 -1.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5375 -2.4000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7750 -3.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8917 -3.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8917 -1.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6500 0.4333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5417 -0.9667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3042 -2.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8875 -0.2750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3042 -1.6792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3625 -3.8375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3000 -0.9875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4000 -0.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4667 -0.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5667 -4.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4375 -4.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 2 1 0
5 3 2 0
6 2 2 0
7 8 1 0
8 1 1 0
9 10 1 0
10 1 1 0
11 3 1 0
12 18 1 0
13 5 1 0
14 4 1 0
15 14 1 0
16 17 1 0
17 12 1 0
18 11 2 0
19 6 1 0
20 4 2 0
21 15 2 0
22 16 2 0
23 19 2 0
24 15 1 0
25 16 1 0
26 18 1 0
27 20 1 0
28 7 1 0
29 7 1 0
30 9 1 0
31 9 1 0
9 6 1 0
7 5 1 0
12 13 2 0
23 20 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 424.50Molecular Weight (Monoisotopic): 424.2111AlogP: 3.73#Rotatable Bonds: 2Polar Surface Area: 150.70Molecular Species: NEUTRALHBA: 4HBD: 6#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 8#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.63CX Basic pKa: ┄CX LogP: 3.13CX LogD: 3.10Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.41Np Likeness Score: 0.37
References 1. Molteni V, Rhodes D, Rubins K, Hansen M, Bushman FD, Siegel JS.. (2000) A new class of HIV-1 integrase inhibitors: the 3,3,3', 3'-tetramethyl-1,1'-spirobi(indan)-5,5',6,6'-tetrol family., 43 (10): [PMID:10821715 ] [10.1021/jm990600c ]