The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(5S,6S)-5,6-Diacetoxy-7-[(R)-4-chloro-2-hydroxy-2-((Z)-oct-2-enyl)-5-oxo-cyclopent-3-en-(E)-ylidene]-heptanoic acid methyl ester ID: ALA65090
PubChem CID: 5283248
Max Phase: Preclinical
Molecular Formula: C25H35ClO8
Molecular Weight: 499.00
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Punaglandin 4 | punaglandin 4|methyl 5S,6S-diacetoxy-9-oxo-10-chloro-12R-hydroxy-7E,10E,14Z-prostatrienoate-cyclo[8,12R]|CHEMBL65090|CHEBI:169859|LMFA03120033|methyl (5S,6S,7E)-5,6-diacetyloxy-7-[(2R)-4-chloro-2-hydroxy-2-[(Z)-oct-2-enyl]-5-oxocyclopent-3-en-1-ylidene]heptanoate
Canonical SMILES: CCCCC/C=C\C[C@@]1(O)C=C(Cl)C(=O)/C1=C/[C@H](OC(C)=O)[C@H](CCCC(=O)OC)OC(C)=O
Standard InChI: InChI=1S/C25H35ClO8/c1-5-6-7-8-9-10-14-25(31)16-20(26)24(30)19(25)15-22(34-18(3)28)21(33-17(2)27)12-11-13-23(29)32-4/h9-10,15-16,21-22,31H,5-8,11-14H2,1-4H3/b10-9-,19-15-/t21-,22-,25+/m0/s1
Standard InChI Key: HMDYASDJIREJJW-ORSYJHFOSA-N
Molfile:
RDKit 2D
34 34 0 0 0 0 0 0 0 0999 V2000
-1.0209 -7.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1959 -7.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0609 -6.3284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6084 -5.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2734 -6.3284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8459 -6.0746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4582 -6.6274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2432 -6.3736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2856 -7.4342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8979 -7.9870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7253 -8.7938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6829 -7.7332 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8555 -6.9265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4159 -5.5669 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2008 -5.3130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3735 -4.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8132 -5.8659 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6405 -6.6726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2528 -7.2255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0378 -6.9717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6501 -7.5245 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2105 -6.1649 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9954 -5.9111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6096 -5.0167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0581 -6.0738 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
0.3833 -7.6958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4167 -7.9083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1615 -8.4968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0591 -9.2918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8578 -9.4983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0784 -10.2932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8771 -10.4997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4553 -9.9112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2540 -10.1177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15 17 2 0
3 4 1 0
13 18 1 0
7 9 1 1
18 19 1 0
4 5 1 0
19 20 1 0
9 10 1 0
20 21 2 0
5 1 2 0
20 22 1 0
10 11 1 0
22 23 1 0
1 2 1 0
4 24 2 0
10 12 2 0
5 25 1 0
3 6 2 0
2 26 1 6
8 13 1 0
2 27 1 0
27 28 1 0
8 14 1 1
28 29 2 0
6 7 1 0
29 30 1 0
14 15 1 0
30 31 1 0
2 3 1 0
31 32 1 0
15 16 1 0
32 33 1 0
7 8 1 0
33 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 499.00Molecular Weight (Monoisotopic): 498.2020AlogP: 4.08#Rotatable Bonds: 14Polar Surface Area: 116.20Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.41CX Basic pKa: ┄CX LogP: 3.93CX LogD: 3.93Aromatic Rings: ┄Heavy Atoms: 34QED Weighted: 0.13Np Likeness Score: 2.12
References 1. Verbitski SM, Mullally JE, Fitzpatrick FA, Ireland CM.. (2004) Punaglandins, chlorinated prostaglandins, function as potent Michael receptors to inhibit ubiquitin isopeptidase activity., 47 (8): [PMID:15056003 ] [10.1021/jm030448l ] 2. Baker BJ, Scheuer PJ.. (1994) The punaglandins: 10-chloroprostanoids from the octocoral Telesto riisei., 57 (10): [PMID:7857405 ] [10.1021/np50112a003 ]