The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Hydroxy-N-[3-(hydroxy-oct-2-enoyl-amino)-propyl]-2-{[3-(hydroxy-oct-2-enoyl-amino)-propylcarbamoyl]-methyl}-succinamic acid ID: ALA65682
PubChem CID: 11813928
Max Phase: Preclinical
Molecular Formula: C28H48N4O9
Molecular Weight: 584.71
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCC/C=C/C(=O)N(O)CCCNC(=O)CC(O)(CC(=O)NCCCN(O)C(=O)/C=C/CCCCC)C(=O)O
Standard InChI: InChI=1S/C28H48N4O9/c1-3-5-7-9-11-15-25(35)31(40)19-13-17-29-23(33)21-28(39,27(37)38)22-24(34)30-18-14-20-32(41)26(36)16-12-10-8-6-4-2/h11-12,15-16,39-41H,3-10,13-14,17-22H2,1-2H3,(H,29,33)(H,30,34)(H,37,38)/b15-11+,16-12+
Standard InChI Key: ZYPXWYPUWAXTQR-JOBJLJCHSA-N
Molfile:
RDKit 2D
41 40 0 0 0 0 0 0 0 0999 V2000
6.1875 -3.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4750 -3.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9042 -3.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1792 -4.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1792 -2.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1875 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6167 -3.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7542 -3.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1917 -3.3042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1875 -3.3042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8917 -2.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4667 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4625 -4.9417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8917 -2.0542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4625 -2.0667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6167 -4.5417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7542 -4.5417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8875 -1.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4542 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0417 -3.3042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3292 -3.3042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1792 -2.8875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8917 -4.9542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9042 -3.7167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6000 -3.8875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7625 -3.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6167 -3.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4750 -3.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9042 -3.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0417 -3.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3292 -3.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7417 -0.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5917 -0.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0292 -1.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3167 -1.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6042 -1.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7417 -1.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0250 -0.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3167 -0.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4542 -0.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8875 -0.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 1 1 0
5 10 1 0
6 9 1 0
7 3 1 0
8 2 1 0
9 28 1 0
10 29 1 0
11 5 1 0
12 6 1 0
13 4 2 0
14 6 2 0
15 5 2 0
16 7 2 0
17 8 2 0
18 11 2 0
19 12 2 0
20 8 1 0
21 7 1 0
22 1 1 0
23 4 1 0
24 9 1 0
25 10 1 0
26 30 1 0
27 31 1 0
28 26 1 0
29 27 1 0
30 21 1 0
31 20 1 0
32 19 1 0
33 18 1 0
34 32 1 0
35 33 1 0
36 39 1 0
37 38 1 0
38 35 1 0
39 34 1 0
40 37 1 0
41 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 584.71Molecular Weight (Monoisotopic): 584.3421AlogP: 2.30#Rotatable Bonds: 23Polar Surface Area: 196.81Molecular Species: ACIDHBA: 8HBD: 6#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 3.55CX Basic pKa: ┄CX LogP: 1.51CX LogD: -1.88Aromatic Rings: ┄Heavy Atoms: 41QED Weighted: 0.05Np Likeness Score: 0.35
References 1. Guo H, Naser SA, Ghobrial G, Phanstiel O.. (2002) Synthesis and biological evaluation of new citrate-based siderophores as potential probes for the mechanism of iron uptake in mycobacteria., 45 (10): [PMID:11985473 ] [10.1021/jm0104522 ]