The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-{[7-Chloro-2-(4-hydroxy-piperidin-1-ylmethyl)-3-methyl-4-oxo-3,4-dihydro-quinazolin-6-ylmethyl]-prop-2-ynyl-amino}-N-pyridin-3-ylmethyl-benzamide ID: ALA68216
PubChem CID: 10918968
Max Phase: Preclinical
Molecular Formula: C32H33ClN6O3
Molecular Weight: 585.11
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C#CCN(Cc1cc2c(=O)n(C)c(CN3CCC(O)CC3)nc2cc1Cl)c1ccc(C(=O)NCc2cccnc2)cc1
Standard InChI: InChI=1S/C32H33ClN6O3/c1-3-13-39(25-8-6-23(7-9-25)31(41)35-19-22-5-4-12-34-18-22)20-24-16-27-29(17-28(24)33)36-30(37(2)32(27)42)21-38-14-10-26(40)11-15-38/h1,4-9,12,16-18,26,40H,10-11,13-15,19-21H2,2H3,(H,35,41)
Standard InChI Key: PFKZEWMJZIFXKQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
-1.7250 -1.5042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0208 -1.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7250 -2.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3083 -1.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0208 -2.7417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3083 -2.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1167 -1.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4042 -1.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4042 -2.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8375 -1.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1167 -2.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4458 -3.5667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8292 -1.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4458 -2.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5417 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2500 -0.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9542 0.1583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5500 -1.0792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0208 -0.2667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0125 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3667 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0542 -2.2917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6667 0.1833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6000 -2.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5917 -0.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7792 -2.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7750 -0.7875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9750 -1.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1583 -4.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7250 -4.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1500 -3.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7208 -3.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2667 -1.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4458 -1.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8292 -2.7417 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.5417 -0.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4375 -5.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9625 -0.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4458 -6.0417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3917 -0.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6917 -1.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4042 -1.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 2 1 0
5 3 2 0
6 5 1 0
7 8 1 0
8 4 2 0
9 6 2 0
10 20 1 0
11 9 1 0
12 14 1 0
13 7 1 0
14 3 1 0
15 13 1 0
16 36 1 0
17 16 3 0
18 10 1 0
19 2 2 0
20 25 1 0
21 15 1 0
22 10 2 0
23 38 2 0
24 26 1 0
25 27 2 0
26 21 2 0
27 21 1 0
28 33 1 0
29 31 1 0
30 32 1 0
31 12 1 0
32 12 1 0
33 18 1 0
34 1 1 0
35 11 1 0
36 15 1 0
37 30 1 0
38 28 1 0
37 39 1 0
40 42 2 0
41 28 2 0
42 41 1 0
6 4 1 0
7 11 2 0
37 29 1 0
20 24 2 0
40 23 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 585.11Molecular Weight (Monoisotopic): 584.2303AlogP: 3.51#Rotatable Bonds: 9Polar Surface Area: 103.59Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 6.22CX LogP: 2.45CX LogD: 2.42Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.29Np Likeness Score: -1.60
References 1. Bavetsias V, Skelton LA, Yafai F, Mitchell F, Wilson SC, Allan B, Jackman AL.. (2002) The design and synthesis of water-soluble analogues of CB30865, a quinazolin-4-one-based antitumor agent., 45 (17): [PMID:12166942 ] [10.1021/jm011081s ]