The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-3-{2-[3-((2S,3S)-2-Acetylamino-3-methyl-pentanoylamino)-2-oxo-2H-pyridin-1-yl]-acetylamino}-4-oxo-butyric acid ID: ALA69482
PubChem CID: 44309888
Max Phase: Preclinical
Molecular Formula: C19H26N4O7
Molecular Weight: 422.44
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@H](C)[C@H](NC(C)=O)C(=O)Nc1cccn(CC(=O)N[C@H](C=O)CC(=O)O)c1=O
Standard InChI: InChI=1S/C19H26N4O7/c1-4-11(2)17(20-12(3)25)18(29)22-14-6-5-7-23(19(14)30)9-15(26)21-13(10-24)8-16(27)28/h5-7,10-11,13,17H,4,8-9H2,1-3H3,(H,20,25)(H,21,26)(H,22,29)(H,27,28)/t11-,13-,17-/m0/s1
Standard InChI Key: RDCICWNDKXBQAM-BNLOLNQZSA-N
Molfile:
RDKit 2D
30 30 0 0 1 0 0 0 0 0999 V2000
4.7625 -6.3167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2375 -6.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7125 -6.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6375 -6.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1875 -6.6042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2042 -6.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8125 -6.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6542 -6.5667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2792 -6.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8625 -5.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3875 -5.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7667 -5.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2250 -6.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7125 -5.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3292 -6.6292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2375 -5.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2292 -7.2292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5250 -5.8042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8125 -5.7167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8625 -6.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9125 -5.7292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3417 -7.5417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9125 -6.3292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3167 -7.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3792 -6.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3917 -4.8167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6750 -6.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8875 -7.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8667 -7.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0042 -8.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
5 3 1 0
6 4 1 0
7 9 1 0
6 8 1 6
9 1 1 0
20 10 1 1
11 10 1 0
12 1 1 0
13 8 1 0
14 16 1 0
15 7 1 0
16 12 2 0
17 2 2 0
18 4 2 0
19 7 2 0
20 15 1 0
21 11 2 0
22 13 2 0
23 25 2 0
24 6 1 0
25 20 1 0
26 11 1 0
27 13 1 0
28 24 1 0
24 29 1 1
30 28 1 0
14 3 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 422.44Molecular Weight (Monoisotopic): 422.1801AlogP: -0.50#Rotatable Bonds: 11Polar Surface Area: 163.67Molecular Species: ACIDHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.90CX Basic pKa: ┄CX LogP: -1.89CX LogD: -5.10Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.35Np Likeness Score: -0.57
References 1. Willoughby CA, Bull HG, Garcia-Calvo M, Jiang J, Chapman KT, Thornberry NA.. (2002) Discovery of potent, selective human granzyme B inhibitors that inhibit CTL mediated apoptosis., 12 (16): [PMID:12127536 ] [10.1016/s0960-894x(02)00363-3 ]