4'-[3-(3-Dimethylamino-propyl)-4-methoxy-benzoylamino]-2-methyl-biphenyl-4-carboxylic acid 2-methoxy-ethyl ester

ID: ALA73446

PubChem CID: 10346019

Max Phase: Preclinical

Molecular Formula: C30H36N2O5

Molecular Weight: 504.63

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COCCOC(=O)c1ccc(-c2ccc(NC(=O)c3ccc(OC)c(CCCN(C)C)c3)cc2)c(C)c1

Standard InChI:  InChI=1S/C30H36N2O5/c1-21-19-25(30(34)37-18-17-35-4)10-14-27(21)22-8-12-26(13-9-22)31-29(33)24-11-15-28(36-5)23(20-24)7-6-16-32(2)3/h8-15,19-20H,6-7,16-18H2,1-5H3,(H,31,33)

Standard InChI Key:  RYJKLOQHRYQMKA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
    2.8167   -2.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9000   -2.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3125   -2.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6500   -2.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3833   -2.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4042   -2.0250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5583   -2.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1458   -2.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0625   -2.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3125   -1.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8917   -2.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0708   -2.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3042   -2.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4042   -3.4542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1458   -1.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7875   -2.7500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0625   -3.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8917   -3.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5792   -2.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3417   -1.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3417   -2.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8000   -1.3167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9250    0.8583    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1667   -1.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1667   -2.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1292   -2.7375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3167   -1.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9000   -3.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9042   -0.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4208    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3292    0.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0917    0.8708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3500    1.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3958   -0.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8208    0.1083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5417   -3.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8375    1.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2 12  1  0
  3  2  2  0
  4  1  1  0
  5  7  1  0
  6  1  1  0
  7 15  1  0
  8  3  1  0
  9  4  1  0
 10  2  1  0
 11  9  2  0
 12 21  2  0
 13 18  2  0
 14  1  2  0
 15 10  2  0
 16  5  2  0
 17  4  2  0
 18 17  1  0
 19  6  1  0
 20 24  2  0
 21 25  1  0
 22  5  1  0
 23 31  1  0
 24 19  1  0
 25 19  2  0
 26 13  1  0
 27 11  1  0
 28  3  1  0
 29 27  1  0
 30 35  1  0
 31 29  1  0
 32 23  1  0
 33 23  1  0
 34 22  1  0
 35 34  1  0
 36 26  1  0
 37 30  1  0
 12 20  1  0
 13 11  1  0
  7  8  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA73446

   2-Methoxyethyl 4-[4-[[3-[3-(dimethylamino)propyl]-4-methoxybenzoyl]amino]phenyl]-3-methylbenzoate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 504.63

Molecular Weight (Monoisotopic): 504.2624

AlogP: 5.22

#Rotatable Bonds: 12

Polar Surface Area: 77.10

Molecular Species: BASE

HBA: 6

HBD: 1

#RO5 Violations: 2

HBA (Lipinski): 7

HBD (Lipinski): 1

#RO5 Violations (Lipinski): 2

CX Acidic pKa: ┄

CX Basic pKa: 9.53

CX LogP: 5.70

CX LogD: 3.58

Aromatic Rings: 3

Heavy Atoms: 37

QED Weighted: 0.27

Np Likeness Score: -0.92

References

1. Clitherow JW, Scopes DI, Skingle M, Jordan CC, Feniuk W, Campbell IB, Carter MC, Collington EW, Connor HE, Higgins GA..  (1994)  Evolution of a novel series of [(N,N-dimethylamino)propyl]- and piperazinylbenzanilides as the first selective 5-HT1D antagonists.,  37  (15): [PMID:8057272] [10.1021/jm00041a001]

Source

Source(1):

• Scientific Literature