The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,3R)-N*4*-((R)-2,2-Dimethyl-1-methylcarbamoyl-propyl)-2-(1,3-dioxo-1,3-dihydro-isoindol-2-ylmethyl)-N*1*-hydroxy-3-isobutyl-succinamide ID: ALA74670
PubChem CID: 44313736
Max Phase: Preclinical
Molecular Formula: C24H34N4O6
Molecular Weight: 474.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)[C@H](NC(=O)[C@H](CC(C)C)[C@@H](CN1C(=O)c2ccccc2C1=O)C(=O)NO)C(C)(C)C
Standard InChI: InChI=1S/C24H34N4O6/c1-13(2)11-16(19(29)26-18(21(31)25-6)24(3,4)5)17(20(30)27-34)12-28-22(32)14-9-7-8-10-15(14)23(28)33/h7-10,13,16-18,34H,11-12H2,1-6H3,(H,25,31)(H,26,29)(H,27,30)/t16-,17-,18+/m1/s1
Standard InChI Key: KYOFVPKPPTUVKK-KURKYZTESA-N
Molfile:
RDKit 2D
34 35 0 0 1 0 0 0 0 0999 V2000
-1.9708 -0.7625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7875 -0.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6458 -1.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2583 0.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2583 -0.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1667 0.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9625 -1.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2583 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8875 0.8875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5458 0.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6000 0.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9708 0.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3167 0.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8375 -1.6917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3375 -0.2292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6000 -0.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1667 -0.3500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5458 1.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9708 1.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0292 0.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6833 0.4750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3167 1.7125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2708 -2.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6833 -2.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4833 0.2625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1667 2.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5125 -1.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8500 -0.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4542 -0.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0292 2.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0458 2.9333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8792 2.5458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6875 -2.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9750 -3.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 5 1 1
5 1 1 0
6 10 1 0
7 2 1 0
8 3 1 0
9 6 1 0
10 4 1 0
11 9 1 0
12 4 1 0
13 11 1 0
14 3 2 0
15 2 2 0
11 16 1 1
17 6 2 0
10 18 1 1
19 12 2 0
20 13 2 0
21 12 1 0
22 13 1 0
23 8 1 0
24 7 1 0
25 21 1 0
26 18 1 0
27 16 1 0
28 16 1 0
29 16 1 0
30 22 1 0
31 26 1 0
32 26 1 0
33 24 2 0
34 23 2 0
7 8 2 0
34 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 474.56Molecular Weight (Monoisotopic): 474.2478AlogP: 1.34#Rotatable Bonds: 9Polar Surface Area: 144.91Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.85CX Basic pKa: ┄CX LogP: 1.35CX LogD: 1.34Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.24Np Likeness Score: -0.01
References 1. Broadhurst M, Brown P, Lawton G, Ballantyne N, Borkakoti N, Bottomley K, Cooper M, Eatherton A, Kilford I, Malsher P, Nixon J, Lewis E, Sutton B, Johnson W. (1997) Design and synthesis of the cartilage protective agent (CPA, Ro32-3555), 7 (17): [10.1016/S0960-894X(97)00416-2 ]