1H-Indole-2-carboxylic acid [2-((S)-8-chloromethyl-4-hydroxy-1-methyl-7,8-dihydro-furo[3,2-e]indole-6-carbonyl)-benzo[b]thiophen-5-yl]-amide

ID: ALA77091

PubChem CID: 10437693

Max Phase: Preclinical

Molecular Formula: C30H22ClN3O4S

Molecular Weight: 556.04

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1coc2c(O)cc3c(c12)[C@H](CCl)CN3C(=O)c1cc2cc(NC(=O)c3cc4ccccc4[nH]3)ccc2s1

Standard InChI:  InChI=1S/C30H22ClN3O4S/c1-15-14-38-28-23(35)11-22-27(26(15)28)18(12-31)13-34(22)30(37)25-10-17-8-19(6-7-24(17)39-25)32-29(36)21-9-16-4-2-3-5-20(16)33-21/h2-11,14,18,33,35H,12-13H2,1H3,(H,32,36)/t18-/m1/s1

Standard InChI Key:  MRDDJURJHLXBQH-GOSISDBHSA-N

Molfile:  

     RDKit          2D

 39 45  0  0  1  0  0  0  0  0999 V2000
    2.8042   -1.6417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0167   -1.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9917   -0.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9000   -2.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0875   -2.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2750   -0.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8000   -2.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2542   -3.3125    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.7625   -0.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4792   -3.0542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5667   -0.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2667   -0.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3167   -1.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4917   -1.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0583   -0.1167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0250   -2.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0250   -1.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5917   -1.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2167   -2.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0750    0.5875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0750   -3.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2500    0.6458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1292   -2.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3917   -2.3500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8500   -1.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5542   -3.0542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9917   -2.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6167   -2.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8792   -3.6917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7042   -3.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1083   -1.9042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9917    0.4708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4750   -3.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7917    0.6625    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.6042    1.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9417   -2.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3750   -1.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1792   -1.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4667   -2.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  5  1  0
  5  1  1  0
  6  3  1  0
  7 16  1  0
  8  4  1  0
  9 12  1  0
 10  7  1  0
 11 18  1  0
 12  1  1  0
 13  2  1  0
 14  4  2  0
 15 11  1  0
 16 24  1  0
 17  7  2  0
 18 13  2  0
 19 14  1  0
 20  6  1  0
 21  8  1  0
 22 20  2  0
 23 10  1  0
 24 28  1  0
 25 17  1  0
 26  5  2  0
 27 19  1  0
 28 27  2  0
 29 16  2  0
 30 21  1  0
 31 18  1  0
  9 32  1  6
 33 30  2  0
 34 32  1  0
 35 20  1  0
 36 23  1  0
 37 25  1  0
 38 37  2  0
 39 36  2  0
  3  9  1  0
 21 19  2  0
 11  6  2  0
 15 22  1  0
 28 33  1  0
 23 25  2  0
 38 39  1  0
M  END

Associated Targets(Human)

T222 (11 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 556.04Molecular Weight (Monoisotopic): 555.1020AlogP: 7.38#Rotatable Bonds: 4
Polar Surface Area: 98.57Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.16CX Basic pKa: CX LogP: 5.78CX LogD: 5.35
Aromatic Rings: 6Heavy Atoms: 39QED Weighted: 0.20Np Likeness Score: -0.82

References

1. Mohamadi F, Spees MM, Staten GS, Marder P, Kipka JK, Johnson DA, Boger DL, Zarrinmayeh H..  (1994)  Total synthesis and biological properties of novel antineoplastic (chloromethyl)furanoindolines: an asymmetric hydroboration mediated synthesis of the alkylation subunits.,  37  (2): [PMID:8295210] [10.1021/jm00028a005]

Source