The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Benzo[b]thiophene-2-carboxylic acid [2-((S)-8-chloromethyl-4-hydroxy-1-methyl-7,8-dihydro-furo[3,2-e]indole-6-carbonyl)-benzofuran-5-yl]-amide ID: ALA80467
PubChem CID: 10415332
Max Phase: Preclinical
Molecular Formula: C30H21ClN2O5S
Molecular Weight: 557.03
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1coc2c(O)cc3c(c12)[C@H](CCl)CN3C(=O)c1cc2cc(NC(=O)c3cc4ccccc4s3)ccc2o1
Standard InChI: InChI=1S/C30H21ClN2O5S/c1-15-14-37-28-21(34)11-20-27(26(15)28)18(12-31)13-33(20)30(36)23-9-17-8-19(6-7-22(17)38-23)32-29(35)25-10-16-4-2-3-5-24(16)39-25/h2-11,14,18,34H,12-13H2,1H3,(H,32,35)/t18-/m1/s1
Standard InChI Key: APKYIYKMCJGFOP-GOSISDBHSA-N
Molfile:
RDKit 2D
39 45 0 0 1 0 0 0 0 0999 V2000
2.8042 -1.6417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0167 -1.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9917 -0.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9000 -2.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0875 -2.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2750 -0.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8000 -2.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7625 -0.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4792 -3.0542 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.5667 -0.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2542 -3.3125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2667 -0.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3167 -1.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4917 -1.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0583 -0.1167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0250 -2.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0250 -1.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5917 -1.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2167 -2.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0750 0.5875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2500 0.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0750 -3.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1292 -2.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3917 -2.3500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8500 -1.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5542 -3.0542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9917 -2.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6167 -2.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8792 -3.6917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7042 -3.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1083 -1.9042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9917 0.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4750 -3.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7917 0.6625 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.6042 1.2208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9417 -2.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3750 -1.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1792 -1.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4667 -2.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
4 5 1 0
5 1 1 0
6 3 1 0
7 16 1 0
8 12 1 0
9 7 1 0
10 18 1 0
11 4 1 0
12 1 1 0
13 2 1 0
14 4 2 0
15 10 1 0
16 24 1 0
17 7 2 0
18 13 2 0
19 14 1 0
20 6 1 0
21 20 2 0
22 11 1 0
23 9 1 0
24 28 1 0
25 17 1 0
26 5 2 0
27 19 1 0
28 27 2 0
29 16 2 0
30 22 1 0
31 18 1 0
8 32 1 6
33 30 2 0
34 32 1 0
35 20 1 0
36 23 1 0
37 25 1 0
38 37 2 0
39 36 2 0
3 8 1 0
22 19 2 0
10 6 2 0
15 21 1 0
28 33 1 0
23 25 2 0
38 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 557.03Molecular Weight (Monoisotopic): 556.0860AlogP: 7.64#Rotatable Bonds: 4Polar Surface Area: 95.92Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.16CX Basic pKa: ┄CX LogP: 5.84CX LogD: 5.41Aromatic Rings: 6Heavy Atoms: 39QED Weighted: 0.22Np Likeness Score: -0.80
References 1. Mohamadi F, Spees MM, Staten GS, Marder P, Kipka JK, Johnson DA, Boger DL, Zarrinmayeh H.. (1994) Total synthesis and biological properties of novel antineoplastic (chloromethyl)furanoindolines: an asymmetric hydroboration mediated synthesis of the alkylation subunits., 37 (2): [PMID:8295210 ] [10.1021/jm00028a005 ]