{3-[2-(4-Methoxy-benzyloxy)-phenyl]-4,5-dihydro-isoxazol-5-yl}-methanol

ID: ALA81937

PubChem CID: 44318403

Max Phase: Preclinical

Molecular Formula: C18H19NO4

Molecular Weight: 313.35

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(COc2ccccc2C2=NOC(CO)C2)cc1

Standard InChI:  InChI=1S/C18H19NO4/c1-21-14-8-6-13(7-9-14)12-22-18-5-3-2-4-16(18)17-10-15(11-20)23-19-17/h2-9,15,20H,10-12H2,1H3

Standard InChI Key:  JGLNXBMTQBCOOB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
    0.6667    2.2208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.8292    1.4083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1167    0.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3792    2.6208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6542    1.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1167    0.1583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9875    2.0708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8292   -0.2542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8292   -1.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1042   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3208   -2.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6083   -1.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1042   -2.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6083   -2.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3208   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6083    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0458   -2.7417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3625    1.6458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8000    2.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6000   -0.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7583   -2.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3208    0.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3208    0.1583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  1  1  0
  5  2  1  0
  6  3  1  0
  7  4  1  0
  8  6  1  0
  9  8  1  0
 10  9  1  0
 11 14  1  0
 12 10  2  0
 13 10  1  0
 14 13  2  0
 15 12  1  0
 16  3  2  0
 17 11  1  0
 18 19  1  0
 19  7  1  0
 20  6  2  0
 21 17  1  0
 22 16  1  0
 23 22  2  0
  7  5  1  0
 20 23  1  0
 11 15  2  0
M  END

Associated Targets(non-human)

Cftr Cystic fibrosis transmembrane conductance regulator (71 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 313.35Molecular Weight (Monoisotopic): 313.1314AlogP: 2.76#Rotatable Bonds: 6
Polar Surface Area: 60.28Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.32CX LogP: 2.64CX LogD: 2.64
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.89Np Likeness Score: -0.38

References

1. Sammelson RE, Ma T, Galietta LJ, Verkman AS, Kurth MJ..  (2003)  3-(2-Benzyloxyphenyl)isoxazoles and isoxazolines: synthesis and evaluation as CFTR activators.,  13  (15): [PMID:12852954] [10.1016/s0960-894x(03)00482-7]

Source