The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-{4-[2-(2,3-Dioxo-5-trifluoromethoxy-2,3-dihydro-indol-1-yl)-acetyl]-piperazine-1-carbonyl}-3-naphthalen-1-yl-urea ID: ALA82234
PubChem CID: 44462197
Max Phase: Preclinical
Molecular Formula: C27H22F3N5O6
Molecular Weight: 569.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NC(=O)N1CCN(C(=O)CN2C(=O)C(=O)c3cc(OC(F)(F)F)ccc32)CC1)Nc1cccc2ccccc12
Standard InChI: InChI=1S/C27H22F3N5O6/c28-27(29,30)41-17-8-9-21-19(14-17)23(37)24(38)35(21)15-22(36)33-10-12-34(13-11-33)26(40)32-25(39)31-20-7-3-5-16-4-1-2-6-18(16)20/h1-9,14H,10-13,15H2,(H2,31,32,39,40)
Standard InChI Key: IQSHNKNWNQVLDJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
1.4917 -11.3417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9792 -12.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7125 -12.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5000 -12.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7042 -11.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1250 -7.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8375 -6.7125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8375 -5.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7000 -10.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4917 -10.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1250 -7.9417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7042 -9.5375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1583 -12.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5500 -5.4792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5417 -4.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0083 -11.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0083 -12.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8042 -12.0042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2542 -4.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7542 -13.4625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4042 -6.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4375 -12.8417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3292 -8.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7042 -8.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1167 -8.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4917 -9.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1167 -5.4792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0792 -10.9125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7208 -12.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2958 -11.5750 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.9708 -12.7417 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.8125 -12.0542 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.2542 -3.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7208 -11.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8292 -4.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8292 -3.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9625 -4.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5417 -3.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9667 -3.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6750 -4.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6750 -3.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 5 1 0
4 2 1 0
5 1 1 0
6 11 1 0
7 6 1 0
8 7 1 0
9 1 1 0
10 9 1 0
11 24 1 0
12 10 1 0
13 22 1 0
14 8 1 0
15 14 1 0
16 5 2 0
17 3 2 0
18 2 2 0
19 15 1 0
20 4 2 0
21 6 2 0
22 29 1 0
23 25 1 0
24 26 1 0
25 12 1 0
26 12 1 0
27 8 2 0
28 10 2 0
29 34 2 0
30 13 1 0
31 13 1 0
32 13 1 0
33 19 1 0
34 16 1 0
35 15 2 0
36 35 1 0
37 19 2 0
38 36 2 0
39 33 2 0
40 37 1 0
41 40 2 0
3 4 1 0
17 29 1 0
23 11 1 0
33 38 1 0
41 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 569.50Molecular Weight (Monoisotopic): 569.1522AlogP: 3.35#Rotatable Bonds: 4Polar Surface Area: 128.36Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.96CX Basic pKa: ┄CX LogP: 2.99CX LogD: 2.99Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.46Np Likeness Score: -1.38
References 1. Shuttleworth SJ, Nasturica D, Gervais C, Siddiqui MA, Rando RF, Lee N.. (2000) Parallel synthesis of isatin-based serine protease inhibitors., 10 (22): [PMID:11086715 ] [10.1016/s0960-894x(00)00523-0 ]