The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-Amino-2-{4-[(2,4-diamino-pteridin-6-ylmethyl)-methyl-amino]-benzoylamino}-4,4-difluoro-pentanoic acid ID: ALA83644
PubChem CID: 10457642
Max Phase: Preclinical
Molecular Formula: C20H23F2N9O3
Molecular Weight: 475.46
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)NC(CC(F)(F)CN)C(=O)O)cc1
Standard InChI: InChI=1S/C20H23F2N9O3/c1-31(8-11-7-26-16-14(27-11)15(24)29-19(25)30-16)12-4-2-10(3-5-12)17(32)28-13(18(33)34)6-20(21,22)9-23/h2-5,7,13H,6,8-9,23H2,1H3,(H,28,32)(H,33,34)(H4,24,25,26,29,30)
Standard InChI Key: AVMOJIXENQBMTQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
0.8000 -1.6292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5042 -2.8667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2167 -1.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2125 -2.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5042 -1.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8000 -2.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9292 -1.2167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3625 -1.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7750 -2.3542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9250 -2.8667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6000 -2.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0167 -3.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0125 -1.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4292 -3.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6417 -1.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0750 -1.6417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5375 -1.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3625 -1.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9000 -1.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3625 -0.8167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8292 -1.6292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6417 -2.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5042 -0.3917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1250 -0.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1250 -2.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3000 -0.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3042 -2.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0792 -2.8667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7000 -3.6167 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.2500 -3.7542 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.6000 -0.9292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2500 -4.9417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8375 -4.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0667 -0.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 6 2 0
3 5 1 0
4 2 1 0
5 1 2 0
6 1 1 0
7 3 1 0
8 17 1 0
9 8 1 0
10 4 1 0
11 9 1 0
12 11 1 0
13 11 1 0
14 12 1 0
15 7 2 0
16 18 1 0
17 25 1 0
18 15 1 0
19 16 1 0
20 8 2 0
21 13 2 0
22 10 2 0
23 5 1 0
24 26 1 0
25 27 2 0
26 19 2 0
27 19 1 0
28 6 1 0
29 14 1 0
30 14 1 0
31 13 1 0
32 33 1 0
33 14 1 0
34 16 1 0
4 3 2 0
22 15 1 0
17 24 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 475.46Molecular Weight (Monoisotopic): 475.1892AlogP: 0.39#Rotatable Bonds: 9Polar Surface Area: 199.26Molecular Species: ACIDHBA: 10HBD: 5#RO5 Violations: ┄HBA (Lipinski): 12HBD (Lipinski): 8#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.83CX Basic pKa: 7.31CX LogP: -2.10CX LogD: -2.40Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.29Np Likeness Score: -0.75
References 1. Tsukamoto T, Haile WH, McGuire JJ, Coward JK.. (1996) Synthesis and biological evaluation of N alpha-(4-amino-4-deoxy-10-methylpteroyl)-DL-4,4-difluoroornithine., 39 (13): [PMID:8691451 ] [10.1021/jm960046w ]