The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1H-Benzoimidazole-2-carboxylic acid {1-[1-cyclohexylmethyl-2-hydroxy-4-(2-morpholin-4-yl-ethylcarbamoyl)-hept-6-ynylcarbamoyl]-2-methylsulfanyl-ethyl}-amide ID: ALA83697
PubChem CID: 10484275
Max Phase: Preclinical
Molecular Formula: C33H48N6O5S
Molecular Weight: 640.85
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C#CC[C@H](C[C@H](O)[C@H](CC1CCCCC1)NC(=O)[C@H](CSC)NC(=O)c1nc2ccccc2[nH]1)C(=O)NCCN1CCOCC1
Standard InChI: InChI=1S/C33H48N6O5S/c1-3-9-24(31(41)34-14-15-39-16-18-44-19-17-39)21-29(40)27(20-23-10-5-4-6-11-23)37-32(42)28(22-45-2)38-33(43)30-35-25-12-7-8-13-26(25)36-30/h1,7-8,12-13,23-24,27-29,40H,4-6,9-11,14-22H2,2H3,(H,34,41)(H,35,36)(H,37,42)(H,38,43)/t24-,27+,28+,29+/m1/s1
Standard InChI Key: MDCNERSXJOKFTF-KHUDPXOFSA-N
Molfile:
RDKit 2D
45 48 0 0 1 0 0 0 0 0999 V2000
1.7625 -2.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2667 -2.2542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2792 -3.6042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5875 -2.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6792 -3.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1667 -3.5042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9667 -3.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3917 -3.2792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4792 -2.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4875 -3.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9625 -3.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1042 -3.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8250 -1.8750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4042 -1.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5292 -3.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8167 -3.6667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8167 -3.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2417 -3.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9000 -2.1542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6792 -4.5250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1000 -4.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9667 -4.5167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6667 -3.2750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2500 -4.4792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2417 -2.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9625 -2.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6667 -2.0417 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.8167 -2.4625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3917 -3.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1042 -3.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8042 -4.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8250 -4.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5292 -3.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2333 -2.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2333 -3.7625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2417 -3.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5375 -4.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6667 -1.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7917 -5.7625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5167 -4.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9458 -2.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9458 -3.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2292 -4.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5042 -6.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2250 -5.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 1 1 0
4 1 1 0
5 7 1 0
6 4 1 0
7 6 1 0
8 5 1 0
9 2 1 0
10 3 1 0
11 18 1 0
12 8 1 0
13 25 1 0
14 13 3 0
15 17 1 0
16 30 1 0
17 12 1 0
18 15 1 0
19 4 2 0
20 5 2 0
12 21 1 6
22 11 2 0
23 11 1 0
24 36 1 0
18 25 1 1
7 26 1 1
27 26 1 0
17 28 1 1
29 23 1 0
30 29 1 0
31 21 1 0
32 16 1 0
33 16 1 0
34 9 2 0
35 10 2 0
36 33 1 0
37 32 1 0
27 38 1 0
39 31 1 0
40 31 1 0
41 34 1 0
42 35 1 0
43 40 1 0
44 39 1 0
45 43 1 0
10 9 1 0
42 41 2 0
44 45 1 0
24 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 640.85Molecular Weight (Monoisotopic): 640.3407AlogP: 2.32#Rotatable Bonds: 16Polar Surface Area: 148.68Molecular Species: NEUTRALHBA: 8HBD: 5#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.66CX Basic pKa: 6.11CX LogP: 2.37CX LogD: 2.34Aromatic Rings: 2Heavy Atoms: 45QED Weighted: 0.18Np Likeness Score: -0.65
References 1. Cozzini P, Fornabaio M, Marabotti A, Abraham DJ, Kellogg GE, Mozzarelli A.. (2002) Simple, intuitive calculations of free energy of binding for protein-ligand complexes. 1. Models without explicit constrained water., 45 (12): [PMID:12036355 ] [10.1021/jm0200299 ]