The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-Amino-2-{4-[(2-amino-4-hydroxy-5,6,7,8-tetrahydro-pteridin-6-ylmethyl)-amino]-benzoylamino}-pentanoic acid ID: ALA83868
PubChem CID: 136026478
Max Phase: Preclinical
Molecular Formula: C19H26N8O4
Molecular Weight: 430.47
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NCCCC(NC(=O)c1ccc(NCC2CNc3nc(N)nc(O)c3N2)cc1)C(=O)O
Standard InChI: InChI=1S/C19H26N8O4/c20-7-1-2-13(18(30)31)25-16(28)10-3-5-11(6-4-10)22-8-12-9-23-15-14(24-12)17(29)27-19(21)26-15/h3-6,12-13,22,24H,1-2,7-9,20H2,(H,25,28)(H,30,31)(H4,21,23,26,27,29)
Standard InChI Key: AFOJGUSQUHNDAR-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
1.8667 -3.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1500 -5.0500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8625 -4.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4375 -3.8125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1500 -3.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4375 -4.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5792 -3.3917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5792 -2.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5792 -5.0500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2917 -2.5792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0125 -1.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0125 -2.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8667 -2.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2917 -3.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5792 -1.3417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3000 -0.9292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7250 -3.8125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2917 -4.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2833 -5.0500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1500 -2.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8667 -3.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1417 -2.5667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4417 -3.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0125 -3.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7292 -0.9375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4375 -2.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1500 -3.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4375 -4.6500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7250 -2.5875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4375 -3.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7250 -3.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 1 1 0
4 5 1 0
5 1 2 0
6 4 2 0
7 1 1 0
8 13 1 0
9 3 1 0
10 8 1 0
11 12 1 0
12 10 1 0
13 21 2 0
14 7 1 0
15 8 2 0
16 11 2 0
17 24 1 0
18 14 1 0
19 6 1 0
20 26 2 0
21 27 1 0
22 5 1 0
23 17 1 0
24 14 1 0
25 11 1 0
26 23 1 0
27 23 2 0
28 30 1 0
29 12 1 0
30 31 1 0
31 29 1 0
9 18 1 0
6 2 1 0
20 13 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.47Molecular Weight (Monoisotopic): 430.2077AlogP: 0.00#Rotatable Bonds: 9Polar Surface Area: 200.54Molecular Species: ZWITTERIONHBA: 10HBD: 8#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 10#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.48CX Basic pKa: 9.90CX LogP: -2.83CX LogD: -2.83Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.27Np Likeness Score: 0.19
References 1. Tsukamoto T, Haile WH, McGuire JJ, Coward JK.. (1996) Synthesis and biological evaluation of N alpha-(4-amino-4-deoxy-10-methylpteroyl)-DL-4,4-difluoroornithine., 39 (13): [PMID:8691451 ] [10.1021/jm960046w ]