1-(2-Naphthalen-2-yl-2-oxo-ethyl)-5-trifluoromethoxy-1H-indole-2,3-dione

ID: ALA84471

PubChem CID: 10363530

Max Phase: Preclinical

Molecular Formula: C21H12F3NO4

Molecular Weight: 399.32

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CN1C(=O)C(=O)c2cc(OC(F)(F)F)ccc21)c1ccc2ccccc2c1

Standard InChI:  InChI=1S/C21H12F3NO4/c22-21(23,24)29-15-7-8-17-16(10-15)19(27)20(28)25(17)11-18(26)14-6-5-12-3-1-2-4-13(12)9-14/h1-10H,11H2

Standard InChI Key:  DEDOTKKBUCBQDO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    4.9667   -7.8542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4500   -7.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1750   -6.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9542   -6.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1792   -7.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2250   -8.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0292   -5.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0167   -8.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4250   -9.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4542   -8.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4542   -6.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2417   -9.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2750   -7.1792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2042   -5.7292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0292   -6.3667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6500  -10.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7417   -6.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5167   -8.1917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0042  -10.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2292  -10.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4125  -10.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3625   -5.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.0292   -4.7917    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.7000   -5.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.7417   -7.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4667  -10.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6417  -11.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8792  -10.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4667  -11.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  5  1  0
  4  2  1  0
  5  1  1  0
  6  1  1  0
  7 15  1  0
  8  6  1  0
  9  8  1  0
 10  5  2  0
 11  3  2  0
 12  9  1  0
 13  2  2  0
 14  4  2  0
 15 17  1  0
 16 12  2  0
 17 25  2  0
 18  8  2  0
 19  9  2  0
 20 21  2  0
 21 19  1  0
 22  7  1  0
 23  7  1  0
 24  7  1  0
 25 10  1  0
 26 16  1  0
 27 20  1  0
 28 26  2  0
 29 27  2  0
  4  3  1  0
 11 17  1  0
 16 20  1  0
 28 29  1  0
M  END

Associated Targets(Human)

CTRC Tchem Chymotrypsin C (381 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ELANE Tclin Leukocyte elastase (8173 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PLG Tclin Plasminogen (2339 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 399.32Molecular Weight (Monoisotopic): 399.0718AlogP: 4.15#Rotatable Bonds: 4
Polar Surface Area: 63.68Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.47CX LogD: 4.47
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.49Np Likeness Score: -0.86

References

1. Shuttleworth SJ, Nasturica D, Gervais C, Siddiqui MA, Rando RF, Lee N..  (2000)  Parallel synthesis of isatin-based serine protease inhibitors.,  10  (22): [PMID:11086715] [10.1016/s0960-894x(00)00523-0]

Source