1-(2-Oxo-2-p-tolyl-ethyl)-1H-indole-2,3-dione

ID: ALA84747

PubChem CID: 28476323

Max Phase: Preclinical

Molecular Formula: C17H13NO3

Molecular Weight: 279.30

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(C(=O)CN2C(=O)C(=O)c3ccccc32)cc1

Standard InChI:  InChI=1S/C17H13NO3/c1-11-6-8-12(9-7-11)15(19)10-18-14-5-3-2-4-13(14)16(20)17(18)21/h2-9H,10H2,1H3

Standard InChI Key:  PJQULSIUMHBSSF-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
    4.8875   -7.3792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3667   -6.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8792   -6.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1000   -7.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0917   -6.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1417   -8.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9417   -8.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1917   -6.7042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1292   -5.2625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3417   -9.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4417   -7.7167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9292   -9.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1625   -9.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3792   -5.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3292  -10.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5667   -9.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1542  -10.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3792   -7.5500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5625  -11.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6667   -6.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6667   -7.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  1  1  0
  5  4  1  0
  6  1  1  0
  7  6  1  0
  8  2  2  0
  9  3  2  0
 10  7  1  0
 11  7  2  0
 12 10  2  0
 13 10  1  0
 14  5  2  0
 15 12  1  0
 16 13  2  0
 17 16  1  0
 18  4  2  0
 19 17  1  0
 20 21  2  0
 21 18  1  0
  3  5  1  0
 14 20  1  0
 15 17  2  0
M  END

Alternative Forms

Associated Targets(Human)

CTRC Tchem Chymotrypsin C (381 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ELANE Tclin Leukocyte elastase (8173 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PLG Tclin Plasminogen (2339 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 279.30Molecular Weight (Monoisotopic): 279.0895AlogP: 2.41#Rotatable Bonds: 3
Polar Surface Area: 54.45Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.56CX LogD: 2.56
Aromatic Rings: 2Heavy Atoms: 21QED Weighted: 0.64Np Likeness Score: -0.96

References

1. Shuttleworth SJ, Nasturica D, Gervais C, Siddiqui MA, Rando RF, Lee N..  (2000)  Parallel synthesis of isatin-based serine protease inhibitors.,  10  (22): [PMID:11086715] [10.1016/s0960-894x(00)00523-0]

Source