The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-Methoxy-naphthalene-2-sulfonic acid [(S)-1-(1-hydroxy-isoquinolin-7-ylmethyl)-2-oxo-pyrrolidin-3-yl]-amide ID: ALA85096
PubChem CID: 44319466
Max Phase: Preclinical
Molecular Formula: C25H23N3O5S
Molecular Weight: 477.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2ccc(S(=O)(=O)N[C@H]3CCN(Cc4ccc5ccnc(O)c5c4)C3=O)cc2c1
Standard InChI: InChI=1S/C25H23N3O5S/c1-33-20-6-4-17-5-7-21(14-19(17)13-20)34(31,32)27-23-9-11-28(25(23)30)15-16-2-3-18-8-10-26-24(29)22(18)12-16/h2-8,10,12-14,23,27H,9,11,15H2,1H3,(H,26,29)/t23-/m0/s1
Standard InChI Key: GRZHOJRWTBYXAL-QHCPKHFHSA-N
Molfile:
RDKit 2D
34 38 0 0 1 0 0 0 0 0999 V2000
3.5042 -1.1000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.4542 -1.1000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9667 -0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4792 -1.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9792 -0.8000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0167 -0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5958 -1.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1083 -0.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0292 -0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4792 -1.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5167 -1.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8042 -1.7542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1792 -1.7250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9417 -0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4542 -1.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6208 -1.1042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9667 -0.2042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0833 -0.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4292 -1.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0292 -0.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5542 -1.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0167 -0.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5958 -1.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5167 0.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5417 0.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0708 -1.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0667 -0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1208 -0.2167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4292 -1.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6208 -1.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0542 -0.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5667 -1.0917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1083 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5667 -1.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 1 1
5 1 1 0
6 1 1 0
7 18 1 0
8 7 2 0
9 11 2 0
10 4 1 0
11 6 1 0
12 1 2 0
13 1 2 0
14 2 1 0
15 10 1 0
16 8 1 0
17 3 2 0
18 19 2 0
19 14 1 0
20 24 2 0
21 9 1 0
22 6 2 0
23 26 1 0
24 22 1 0
25 20 1 0
26 29 2 0
27 21 2 0
28 8 1 0
29 19 1 0
30 33 1 0
31 25 2 0
32 27 1 0
33 23 2 0
34 32 1 0
9 20 1 0
2 15 1 0
27 31 1 0
23 7 1 0
16 30 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 477.54Molecular Weight (Monoisotopic): 477.1358AlogP: 3.18#Rotatable Bonds: 6Polar Surface Area: 108.83Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.03CX Basic pKa: 2.85CX LogP: 2.64CX LogD: 2.64Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.44Np Likeness Score: -1.02
References 1. Choi-Sledeski YM, Becker MR, Green DM, Davis R, Ewing WR, Mason HJ, Ly C, Spada A, Liang G, Cheney D, Barton J, Chu V, Brown K, Colussi D, Bentley R, Leadley R, Dunwiddie C, Pauls HW.. (1999) Aminoisoquinolines: design and synthesis of an orally active benzamidine isostere for the inhibition of factor XA., 9 (17): [PMID:10498204 ] [10.1016/s0960-894x(99)00421-7 ]