The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-Acetyl-phenyl)-3-{4-[2-(5,7-dimethyl-2,3-dioxo-2,3-dihydro-indol-1-yl)-acetyl]-piperazine-1-carbonyl}-urea ID: ALA85676
PubChem CID: 10255600
Max Phase: Preclinical
Molecular Formula: C26H27N5O6
Molecular Weight: 505.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)c1ccc(NC(=O)NC(=O)N2CCN(C(=O)CN3C(=O)C(=O)c4cc(C)cc(C)c43)CC2)cc1
Standard InChI: InChI=1S/C26H27N5O6/c1-15-12-16(2)22-20(13-15)23(34)24(35)31(22)14-21(33)29-8-10-30(11-9-29)26(37)28-25(36)27-19-6-4-18(5-7-19)17(3)32/h4-7,12-13H,8-11,14H2,1-3H3,(H2,27,28,36,37)
Standard InChI Key: WZQQPWOIDVPSDS-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
3.5042 -6.5500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0042 -7.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7292 -7.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7292 -6.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5167 -7.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1417 -2.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8542 -1.9167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7167 -5.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8542 -1.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5167 -5.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1417 -3.1542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7167 -4.7417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0042 -6.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0042 -8.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5667 -0.6875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8292 -7.2125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2917 -6.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7792 -8.6667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4292 -1.9167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3417 -3.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7292 -3.7375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1292 -4.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5167 -4.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5542 2.6083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1417 -0.6875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5542 1.7833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0917 -6.1167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2917 -7.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2667 3.0250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2667 1.3708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8542 1.3708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5667 0.1333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2667 0.5458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8542 0.5458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0042 -5.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8375 3.0208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5792 -8.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 4 1 0
4 1 1 0
5 2 1 0
6 11 1 0
7 6 1 0
8 1 1 0
9 7 1 0
10 8 1 0
11 21 1 0
12 10 1 0
13 4 2 0
14 3 2 0
15 9 1 0
16 2 2 0
17 13 1 0
18 5 2 0
19 6 2 0
20 22 1 0
21 23 1 0
22 12 1 0
23 12 1 0
24 26 1 0
25 9 2 0
26 31 2 0
27 10 2 0
28 17 2 0
29 24 2 0
30 33 2 0
31 34 1 0
32 15 1 0
33 32 1 0
34 32 2 0
35 13 1 0
36 24 1 0
37 28 1 0
3 5 1 0
14 28 1 0
20 11 1 0
30 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 505.53Molecular Weight (Monoisotopic): 505.1961AlogP: 2.12#Rotatable Bonds: 4Polar Surface Area: 136.20Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.02CX Basic pKa: ┄CX LogP: 1.16CX LogD: 1.16Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.48Np Likeness Score: -1.32
References 1. Shuttleworth SJ, Nasturica D, Gervais C, Siddiqui MA, Rando RF, Lee N.. (2000) Parallel synthesis of isatin-based serine protease inhibitors., 10 (22): [PMID:11086715 ] [10.1016/s0960-894x(00)00523-0 ]