3-(3-Chloro-benzyl)-8-methoxy-1,2,3,4-tetrahydro-chromeno[3,4-c]pyridin-5-one

ID: ALA90569

PubChem CID: 10641955

Max Phase: Preclinical

Molecular Formula: C20H18ClNO3

Molecular Weight: 355.82

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc2c3c(c(=O)oc2c1)CN(Cc1cccc(Cl)c1)CC3

Standard InChI:  InChI=1S/C20H18ClNO3/c1-24-15-5-6-17-16-7-8-22(11-13-3-2-4-14(21)9-13)12-18(16)20(23)25-19(17)10-15/h2-6,9-10H,7-8,11-12H2,1H3

Standard InChI Key:  MMTKBQGOVDOJAE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 25 28  0  0  0  0  0  0  0  0999 V2000
    5.5667   -5.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8500   -5.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5667   -6.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8500   -6.9792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1375   -6.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1375   -5.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2792   -4.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2792   -5.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8500   -4.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4250   -6.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4250   -5.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2875   -6.9917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0042   -4.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5625   -4.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0125   -3.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7042   -6.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7042   -5.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7292   -2.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7292   -2.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4417   -1.5917    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.9917   -6.9792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3000   -2.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3000   -2.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0125   -1.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2792   -6.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  1  1  0
  4  3  1  0
  5  4  1  0
  6  2  1  0
  7  8  1  0
  8  1  1  0
  9  2  1  0
 10  5  2  0
 11  6  2  0
 12  3  2  0
 13  7  1  0
 14  7  1  0
 15 13  1  0
 16 10  1  0
 17 11  1  0
 18 15  2  0
 19 18  1  0
 20 19  1  0
 21 16  1  0
 22 23  2  0
 23 15  1  0
 24 22  1  0
 25 21  1  0
  5  6  1  0
 14  9  1  0
 16 17  2  0
 24 19  2  0
M  END

Associated Targets(Human)

DRD4 Tchem Dopamine D4 receptor (7907 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
DRD2 Tclin Dopamine D2 receptor (23596 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
DRD3 Tclin Dopamine D3 receptor (14368 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
DRD2 Tclin Dopamine receptors; D2 & D4 (375 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 355.82Molecular Weight (Monoisotopic): 355.0975AlogP: 4.01#Rotatable Bonds: 3
Polar Surface Area: 42.68Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.74CX LogP: 3.60CX LogD: 3.52
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.67Np Likeness Score: -0.95

References

1. Unangst PC, Capiris T, Connor DT, Heffner TG, MacKenzie RG, Miller SR, Pugsley TA, Wise LD..  (1997)  Chromeno[3,4-c]pyridin-5-ones: selective human dopamine D4 receptor antagonists as potential antipsychotic agents.,  40  (17): [PMID:9276014] [10.1021/jm970170v]
2. Salehian F, Nadri H, Jalili-Baleh L, Youseftabar-Miri L, Abbas Bukhari SN, Foroumadi A, Tüylü Küçükkilinç T, Sharifzadeh M, Khoobi M..  (2021)  A review: Biologically active 3,4-heterocycle-fused coumarins.,  212  [PMID:33276991] [10.1016/j.ejmech.2020.113034]

Source