((3aS,4aS,7aS,7bR)-6,6-Dimethyl-3a,4a,7a,7b-tetrahydro-[1,3]dioxolo[4',5':4,5]furo[2,3-d]isoxazol-3-yl)-methanol

ID: ALA93319

PubChem CID: 480947

Max Phase: Preclinical

Molecular Formula: C9H13NO5

Molecular Weight: 215.21

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1(C)O[C@@H]2O[C@H]3C(CO)=NO[C@H]3[C@@H]2O1

Standard InChI:  InChI=1S/C9H13NO5/c1-9(2)13-7-6-5(12-8(7)14-9)4(3-11)10-15-6/h5-8,11H,3H2,1-2H3/t5-,6+,7-,8-/m0/s1

Standard InChI Key:  PUAVIHWBWBQURE-YWIQKCBGSA-N

Molfile:  

     RDKit          2D

 19 21  0  0  1  0  0  0  0  0999 V2000
    0.7292   -3.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0958   -3.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3458   -3.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9875   -3.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3167   -2.5500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3917   -4.3042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0667   -3.8167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1708   -3.0292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8125   -3.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7625   -4.3042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4333   -3.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3000   -2.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6500   -4.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1500   -3.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1167   -2.4542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2975   -2.0785    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6538   -2.0778    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.2147   -4.7673    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4173   -4.7668    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  1  1  0
  4  5  1  0
  1  6  1  0
  7  6  1  0
  3  8  1  0
  9  4  1  0
  2 10  1  0
 11 10  1  0
 12  9  1  0
 13 11  1  0
 14 11  1  0
 15 12  1  0
  9  7  2  0
  3  5  1  0
 11  8  1  0
  4 16  1  6
  3 17  1  1
  2 18  1  1
  1 19  1  6
M  END

Associated Targets(Human)

GLB1 Tchem Beta-galactosidase (339 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

lacA Beta-galactosidase (64 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
bglA Beta-glucosidase A (127 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 215.21Molecular Weight (Monoisotopic): 215.0794AlogP: -0.39#Rotatable Bonds: 1
Polar Surface Area: 69.51Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 0.71CX LogP: 0.14CX LogD: 0.14
Aromatic Rings: Heavy Atoms: 15QED Weighted: 0.64Np Likeness Score: 1.09

References

1. Schaller C, Demange R, Picasso S, Vogel P..  (1999)  Specific, uncompetitive inhibition of beta-galactosidases by a 5,6-isopropylidenedioxyfuro[2,3-d]isoxazole-3-methanol derivative.,  (2): [PMID:10021944] [10.1016/s0960-894x(98)00722-7]

Source