The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-[8-(3-Dimethylamino-propoxy)-4-(4-fluoro-2-methyl-phenylamino)-quinolin-3-yl]-butan-1-one ID: ALA93579
PubChem CID: 10477403
Max Phase: Preclinical
Molecular Formula: C25H30FN3O2
Molecular Weight: 423.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCC(=O)c1cnc2c(OCCCN(C)C)cccc2c1Nc1ccc(F)cc1C
Standard InChI: InChI=1S/C25H30FN3O2/c1-5-8-22(30)20-16-27-25-19(9-6-10-23(25)31-14-7-13-29(3)4)24(20)28-21-12-11-18(26)15-17(21)2/h6,9-12,15-16H,5,7-8,13-14H2,1-4H3,(H,27,28)
Standard InChI Key: YZMUDYASWPWNPJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
2.7625 -4.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4792 -4.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0500 -4.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7625 -3.4667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7542 -5.9375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0500 -5.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4750 -5.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3125 -2.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1917 -4.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6917 -2.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3417 -5.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2375 -1.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1875 -3.4542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4875 -2.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4167 -1.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0833 -9.2375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3417 -4.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0417 -2.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9667 -0.6917 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.3417 -6.7542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6292 -8.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6292 -4.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5125 -1.9875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9042 -4.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0833 -8.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6292 -5.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6292 -7.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6375 -9.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7958 -9.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6167 -4.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3375 -4.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 1 1 0
4 1 1 0
5 6 1 0
6 3 1 0
7 2 1 0
8 4 1 0
9 2 1 0
10 8 1 0
11 6 2 0
12 10 2 0
13 9 2 0
14 8 2 0
15 18 2 0
16 25 1 0
17 3 2 0
18 14 1 0
19 15 1 0
20 11 1 0
21 27 1 0
22 17 1 0
23 10 1 0
24 9 1 0
25 21 1 0
26 22 2 0
27 20 1 0
28 16 1 0
29 16 1 0
30 24 1 0
31 30 1 0
5 7 2 0
11 26 1 0
15 12 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 423.53Molecular Weight (Monoisotopic): 423.2322AlogP: 5.74#Rotatable Bonds: 10Polar Surface Area: 54.46Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.26CX LogP: 6.15CX LogD: 4.30Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.33Np Likeness Score: -1.38
References 1. Leach CA, Brown TH, Ife RJ, Keeling DJ, Parsons ME, Theobald CJ, Wiggall KJ.. (1995) Reversible inhibitors of the gastric (H+/K+)-ATPase. 4. Identification of an inhibitor with an intermediate duration of action., 38 (14): [PMID:7629813 ] [10.1021/jm00014a026 ]