5-Amino-1-[3,5-dichloro-4-(4-cyano-benzoyl)-benzyl]-1H-[1,2,3]triazole-4-carboxylic acid amide

ID: ALA95393

PubChem CID: 15065219

Max Phase: Preclinical

Molecular Formula: C18H12Cl2N6O2

Molecular Weight: 415.24

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N#Cc1ccc(C(=O)c2c(Cl)cc(Cn3nnc(C(N)=O)c3N)cc2Cl)cc1

Standard InChI:  InChI=1S/C18H12Cl2N6O2/c19-12-5-10(8-26-17(22)15(18(23)28)24-25-26)6-13(20)14(12)16(27)11-3-1-9(7-21)2-4-11/h1-6H,8,22H2,(H2,23,28)

Standard InChI Key:  JIQKVTOCASULCE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   -0.5333   -0.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5333   -1.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0083   -1.7917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5167   -1.4917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5167   -0.8792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5792   -3.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0500   -3.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5750   -2.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0917   -3.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9583   -0.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0083   -2.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0875   -6.6167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5167   -2.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0917   -6.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5167   -3.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0417   -2.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1000   -4.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0583   -1.7917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6167   -3.3167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5375   -0.6042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0917   -2.4042    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.0417   -4.2250    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.5792   -4.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6167   -4.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8083    0.1250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0917   -5.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6167   -5.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5792   -5.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  5  2  0
  5  1  1  0
  6  8  1  0
  7 15  1  0
  8 16  2  0
  9  6  1  0
 10  1  1  0
 11  3  1  0
 12 14  3  0
 13 11  1  0
 14 26  1  0
 15 13  2  0
 16 13  1  0
 17  9  1  0
 18  2  1  0
 19  9  2  0
 20 10  2  0
 21  8  1  0
 22  7  1  0
 23 17  2  0
 24 17  1  0
 25 10  1  0
 26 27  1  0
 27 24  2  0
 28 23  1  0
  3  4  1  0
  7  6  2  0
 28 26  2  0
M  END

Associated Targets(non-human)

Eimeria acervulina (464 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Eimeria tenella (990 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 415.24Molecular Weight (Monoisotopic): 414.0399AlogP: 2.42#Rotatable Bonds: 5
Polar Surface Area: 140.68Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 13.08CX Basic pKa: 0.38CX LogP: 3.42CX LogD: 3.42
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.61Np Likeness Score: -1.73

References

1. Bochis RJ, Chabala JC, Harris E, Peterson LH, Barash L, Beattie T, Brown JE, Graham DW, Waksmunski FS, Tischler M..  (1991)  Benzylated 1,2,3-triazoles as anticoccidiostats.,  34  (9): [PMID:1895303] [10.1021/jm00113a024]

Source