The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(3,5-Bis-cyclopropylmethoxy-phenyl)-7-cyclopropylmethoxy-2-ethyl-6-methoxy-quinazoline ID: ALA97866
PubChem CID: 44329613
Max Phase: Preclinical
Molecular Formula: C29H34N2O4
Molecular Weight: 474.60
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCc1nc(-c2cc(OCC3CC3)cc(OCC3CC3)c2)c2cc(OC)c(OCC3CC3)cc2n1
Standard InChI: InChI=1S/C29H34N2O4/c1-3-28-30-25-14-27(35-17-20-8-9-20)26(32-2)13-24(25)29(31-28)21-10-22(33-15-18-4-5-18)12-23(11-21)34-16-19-6-7-19/h10-14,18-20H,3-9,15-17H2,1-2H3
Standard InChI Key: HWOQSAIEJDCARY-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 40 0 0 0 0 0 0 0 0999 V2000
4.4542 -3.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1750 -4.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4542 -3.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1750 -5.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8875 -3.8792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1667 -2.6417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7417 -4.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7417 -2.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8792 -3.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0292 -3.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0292 -3.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0292 -1.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3292 -7.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3167 -6.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8875 -5.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4542 -5.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9042 -7.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7500 -8.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1542 -7.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4917 -6.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8500 -1.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4375 -0.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3167 -2.6542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4542 -6.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8917 -6.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1750 -6.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6042 -6.7542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7417 -6.7667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3167 -1.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6125 -7.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0292 -6.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3125 -4.3042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5917 -2.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6000 -3.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5917 -1.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 2 1 0
5 2 2 0
6 3 1 0
7 1 2 0
8 3 2 0
9 6 2 0
10 11 2 0
11 7 1 0
12 29 1 0
13 30 1 0
14 31 1 0
15 4 1 0
16 4 2 0
17 14 1 0
18 13 1 0
19 13 1 0
20 14 1 0
21 12 1 0
22 12 1 0
23 10 1 0
24 16 1 0
25 15 2 0
26 24 2 0
27 25 1 0
28 24 1 0
29 23 1 0
30 27 1 0
31 28 1 0
32 11 1 0
33 9 1 0
34 32 1 0
35 33 1 0
8 10 1 0
5 9 1 0
26 25 1 0
22 21 1 0
17 20 1 0
19 18 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 474.60Molecular Weight (Monoisotopic): 474.2519AlogP: 6.23#Rotatable Bonds: 12Polar Surface Area: 62.70Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.38CX LogP: 6.11CX LogD: 6.11Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.31Np Likeness Score: -0.62
References 1. Charpiot B, Brun J, Donze I, Naef R, Stefani M, Mueller T.. (1998) Quinazolines: combined type 3 and 4 phosphodiesterase inhibitors., 8 (20): [PMID:9873643 ] [10.1016/s0960-894x(98)00508-3 ]