The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[4-(3,5-Bis-cyclopropylmethoxy-phenyl)-6-methoxy-2-morpholin-4-yl-quinazolin-7-yloxy]-ethanol ID: ALA98730
PubChem CID: 44329668
Max Phase: Preclinical
Molecular Formula: C29H35N3O6
Molecular Weight: 521.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(-c3cc(OCC4CC4)cc(OCC4CC4)c3)nc(N3CCOCC3)nc2cc1OCCO
Standard InChI: InChI=1S/C29H35N3O6/c1-34-26-15-24-25(16-27(26)36-11-8-33)30-29(32-6-9-35-10-7-32)31-28(24)21-12-22(37-17-19-2-3-19)14-23(13-21)38-18-20-4-5-20/h12-16,19-20,33H,2-11,17-18H2,1H3
Standard InChI Key: MVGFOISECUJJPH-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
4.1542 -1.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1625 -2.5292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4500 -2.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7292 -2.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4417 -1.2917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7292 -1.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4500 -3.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8667 -1.2875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0167 -2.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0167 -1.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3042 -2.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3042 -1.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5917 -5.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6042 -6.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1625 -4.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7292 -4.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2333 -5.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1792 -6.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0250 -7.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4292 -6.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7292 -5.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1667 -5.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4500 -5.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2917 -0.4625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0167 -5.4167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8792 -5.4042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3042 -5.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8875 -6.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5875 -2.9542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5917 -1.3042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5875 -1.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8667 -0.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1250 0.7583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5792 -0.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3000 -1.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1250 -0.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5917 -0.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1250 -2.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
4 6 1 0
5 1 2 0
6 5 1 0
7 3 1 0
8 1 1 0
9 4 2 0
10 6 2 0
11 12 2 0
12 10 1 0
13 27 1 0
14 28 1 0
15 7 1 0
16 7 2 0
17 13 1 0
18 13 1 0
19 14 1 0
20 14 1 0
21 16 1 0
22 15 2 0
23 21 2 0
24 34 1 0
25 21 1 0
26 22 1 0
27 25 1 0
28 26 1 0
29 11 1 0
30 12 1 0
31 8 1 0
32 8 1 0
33 36 1 0
34 32 1 0
35 31 1 0
36 37 1 0
37 30 1 0
38 29 1 0
35 24 1 0
3 4 1 0
11 9 1 0
23 22 1 0
18 17 1 0
20 19 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 521.61Molecular Weight (Monoisotopic): 521.2526AlogP: 4.09#Rotatable Bonds: 12Polar Surface Area: 95.40Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.13CX LogP: 4.27CX LogD: 4.27Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.38Np Likeness Score: -0.76
References 1. Charpiot B, Brun J, Donze I, Naef R, Stefani M, Mueller T.. (1998) Quinazolines: combined type 3 and 4 phosphodiesterase inhibitors., 8 (20): [PMID:9873643 ] [10.1016/s0960-894x(98)00508-3 ]